![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](cover.png){kind=small}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Warm Leatherette.flac | 2025-09-07 16:22 | 41M | |
| 02 Private Life.flac | 2025-09-07 17:00 | 41M | |
| 03 A Rolling Stone.flac | 2025-09-07 17:45 | 27M | |
| 04 Love Is the Drug.flac | 2025-09-07 18:08 | 58M | |
| 05 The Hunter Gets Captured by the Game.flac | 2025-09-07 18:44 | 45M | |
| 06 Bullshit.flac | 2025-09-07 19:21 | 37M | |
| 07 Breakdown.flac | 2025-09-07 19:54 | 32M | |
| 08 Pars.flac | 2025-09-07 20:24 | 32M | |
| album.nfo | 2026-04-02 09:00 | 2.0K | |
| cover.png | 2025-09-06 22:40 | 4.1M | |
| folder.jpg | 2025-01-28 06:27 | 108K | |