![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | spill tab/ | 2026-03-25 22:24 | - | |
| nimino/ | 2026-03-25 17:06 | - | |
| mateo/ | 2026-03-25 14:02 | - | |
| kid creole, kid capri, ecstasy/ | 2026-03-25 20:13 | - | |
| k.d. lang and The Reclines/ | 2026-03-25 12:53 | - | |
| j-hope/ | 2026-03-26 12:31 | - | |
| f5ve/ | 2026-03-25 09:05 | - | |
| deadmau5 _ TESTPILOT/ | 2026-04-19 07:22 | - | |
| deadmau5/ | 2026-04-19 07:20 | - | |
| deadmau5 & The Neptunes/ | 2026-04-19 07:21 | - | |
| d4vd & Kali Uchis/ | 2026-03-25 05:39 | - | |
| casso, RAYE, D-Block Europe/ | 2026-03-25 04:38 | - | |
| alt‐J/ | 2025-11-07 04:23 | - | |
| Zombie Nation/ | 2026-04-19 20:07 | - | |
| Zero Cult/ | 2026-04-19 20:07 | - | |
| Zerb/ | 2026-03-26 02:53 | - | |
| Zerb, Wiz Khalifa & Ty Dolla $ign/ | 2026-03-26 02:54 | - | |
| Zerb, The Chainsmokers & Ink/ | 2026-03-26 02:54 | - | |
| Zeds Dead & Omar LinX/ | 2026-04-19 20:04 | - | |
| Zartmann/ | 2026-03-26 02:52 | - | |
| Zara Larsson/ | 2026-04-19 20:03 | - | |
| Zach Bryan/ | 2026-04-19 20:03 | - | |
| Zac Brown Band/ | 2026-04-19 20:02 | - | |
| Yvette Michele/ | 2026-04-19 20:02 | - | |
| Yrsen/ | 2026-03-25 14:03 | - | |
| Young Jeezy - The Recession (2008) [FLAC]/ | 2026-03-26 02:46 | - | |
| Young Jeezy - The Recession (2008) [FLAC] - Copy/ | 2026-04-19 20:01 | - | |
| YoungBoy Never Broke Again/ | 2026-04-19 20:01 | - | |
| Yo La Tengo/ | 2025-03-25 03:42 | - | |
| Yo-Yo Ma/ | 2026-04-19 20:01 | - | |
| Ye/ | 2026-04-19 19:59 | - | |
| Yann van der Cruyssen/ | 2026-03-26 02:44 | - | |
| Yann Tiersen/ | 2026-01-27 08:19 | - | |
| Yahel-Waves Of Sound-DELUXE EDITION-16BIT-WEB-FLAC-2000-FALCON-FTP/ | 2026-03-26 02:26 | - | |
| Wolfgang Amadeus Mozart; Vienna Philharmonic, Wiener Staatsoper Choir, James Levine/ | 2026-04-19 19:56 | - | |
| Wolfgang Amadeus Mozart; Sir Thomas Allen, Carol Vaness, Maria Ewing, Elizabeth Gale, Keith Lewis, Richard van Allan, John Rawnsley, Dmitri Kavrakos, Glyndebourne Chorus, London Philharmonic Orchestra, Bernard Haitink/ | 2026-04-19 19:56 | - | |
| Wolfgang Amadeus Mozart; Royal Philharmonic Orchestra, Jane Glover/ | 2026-04-19 19:55 | - | |
| Wolfgang Amadeus Mozart; Noordhollands Jongenskoor and Koorschool of the _Grote of St. Laurenskerk_, Alkmaar, Holland, Hendrik Timmerman, Rob Petri, Jan Brink, Robert Overpelt, Gerard Rooker/ | 2026-04-19 19:55 | - | |
| Wolfgang Amadeus Mozart; Gottlieb Wallisch/ | 2026-04-19 19:55 | - | |
| Wolfgang Amadeus Mozart; Ezio Flagello, Dietrich Fischer-Dieskau, Birgit Nilsson, Martti Talvela, Peter Schreier, Martina Arroyo, Reri Grist, Alfredo Mariotti, Czech Philharmonic Chorus, Orchestr Narodniho divadla, Karl Bohm/ | 2026-04-19 19:54 | - | |
| Wolfgang Amadeus Mozart; Antony Pay, Michel Piguet, Academy of Ancient Music, Christopher Hogwood/ | 2026-04-19 19:54 | - | |
| Wolfgang Amadeus Mozart; Anna Tomowa-Sintow, Helga Muller-Molinari, Vinson Cole, Paata Burchuladze, Wiener Singverein, Vienna Philharmonic, Herbert von Karajan/ | 2026-04-19 19:54 | - | |
| Wolfgang Amadeus Mozart/ | 2026-04-19 19:53 | - | |
| Wiz Khalifa/ | 2026-01-06 20:36 | - | |
| Wiz Khalifa, Big K.R.I.T., Girl Talk & Smoke DZA/ | 2025-01-27 01:41 | - | |
| Wiz Khalifa & Curren$y/ | 2025-01-27 01:42 | - | |
| Wilson Pickett/ | 2026-03-26 02:36 | - | |
| Will Sass feat. KAMILLE/ | 2026-03-26 02:34 | - | |
| Whitney Houston/ | 2026-01-21 20:34 | - | |
| Whigfield/ | 2026-04-19 19:47 | - | |
| Westwood/ | 2026-03-26 02:30 | - | |
| Westlife/ | 2026-04-19 19:46 | - | |
| Weird Al Yankovic-The Essential Weird Al Yankovic-2CD-2009-SiRE/ | 2026-03-25 08:56 | - | |
| Ween/ | 2026-04-19 19:45 | - | |
| We Were Evergreen/ | 2026-03-26 02:27 | - | |
| Warhaus/ | 2026-04-19 19:44 | - | |
| W.A. Mozart; Flagello, Fischer‐Dieskau, Nilsson, Talvela, Schreier, Arroyo, Grist, Mariotti, Czech Philharmonic Chorus, Prague National Theatre Orchestra, Karl Böhm/ | 2026-03-26 02:21 | - | |
| Vladimir Cosma/ | 2026-04-19 19:43 | - | |
| Vincent/ | 2026-04-19 19:43 | - | |
| Vince Gill/ | 2026-03-09 04:06 | - | |
| Vince Gill & Paul Franklin/ | 2024-12-18 05:08 | - | |
| Vienna Vienna/ | 2026-03-25 10:17 | - | |
| Victor Ray/ | 2026-03-26 02:14 | - | |
| Vexare/ | 2026-03-26 02:13 | - | |
| Verschiedene Interpreten/ | 2026-04-19 19:40 | - | |
| Vengaboys/ | 2026-04-19 19:38 | - | |
| Various Artists/ | 2026-04-19 18:49 | - | |
| Various/ | 2026-04-19 18:48 | - | |
| Vangelis/ | 2026-03-14 14:45 | - | |
| Vangelis-Mythodea Music For The NASA Mission 2001 Mars Odyssey-CDS-FLAC-2001-MAHOU-FTP/ | 2026-03-25 16:40 | - | |
| VA/ | 2026-04-19 18:47 | - | |
| VA - 100X Zomer 2015 5CD 2015/ | 2026-03-25 23:51 | - | |
| VA - 100X Zomer 2015 5CD 2015 - Copy/ | 2026-04-19 18:47 | - | |
| Usher/ | 2026-04-19 18:46 | - | |
| Unknown Artist/ | 2026-03-25 23:48 | - | |
| Unique II/ | 2026-03-26 16:01 | - | |
| Union Carbide Productions/ | 2026-03-26 04:25 | - | |
| Uncle Kracker/ | 2026-04-19 18:42 | - | |
| UNEQUAL feat. Mondo Cozmo/ | 2026-03-25 23:45 | - | |
| U2/ | 2026-04-22 06:26 | - | |
| Tyler Braden/ | 2026-03-25 23:42 | - | |
| Twista feat. R. Kelly/ | 2026-03-26 09:54 | - | |
| Twista/ | 2026-03-26 05:04 | - | |
| Trivium/ | 2026-04-19 18:38 | - | |
| Trick Pony/ | 2026-03-26 07:38 | - | |
| Travis Scott/ | 2026-04-19 18:36 | - | |
| Travel Sex/ | 2026-03-25 23:34 | - | |
| Trae the Truth/ | 2025-01-26 22:47 | - | |
| Trae tha Truth/ | 2025-01-26 23:04 | - | |
| Trae/ | 2025-01-26 23:27 | - | |
| Tracy Lawrence/ | 2026-03-26 07:29 | - | |
| Tove Lo & SG Lewis/ | 2026-04-19 18:34 | - | |
| Tony Bennett featuring The Count Basie Big Band/ | 2025-01-27 01:41 | - | |
| Tony Bennett feat. The Count Basie Big Band/ | 2024-12-11 04:04 | - | |
| Tony Bennett/ | 2026-01-03 02:20 | - | |
| Tony Bennett & Lady Gaga/ | 2024-12-11 04:05 | - | |
| Tony Bennett & Bill Evans/ | 2024-12-18 05:08 | - | |
| Toni Rios/ | 2026-03-25 02:47 | - | |
| Tom Raybould/ | 2026-03-25 04:20 | - | |
| Todd Thibaud/ | 2026-03-26 04:07 | - | |
| Toby Keith/ | 2026-02-04 09:50 | - | |
| Tobiahs/ | 2026-03-25 23:27 | - | |
| Tito Schipa/ | 2026-03-25 23:25 | - | |
| Tina Turner/ | 2026-04-19 18:28 | - | |
| Tim McGraw/ | 2026-01-06 17:46 | - | |
| Tim Buckley/ | 2026-03-26 15:23 | - | |
| Tiesto/ | 2026-03-25 23:23 | - | |
| Tiesto-Elements Of Life Remixed-2CD-2008-TSP -/ | 2026-03-25 08:22 | - | |
| Tiberius b/ | 2026-03-25 23:19 | - | |
| Tiësto/ | 2025-01-26 23:04 | - | |
| Thrillseekers with York & Asheni/ | 2026-03-25 23:18 | - | |
| Thomas Wesley/ | 2026-03-26 11:05 | - | |
| Thomas Rhett/ | 2026-04-19 18:23 | - | |
| Thomas Rhett-Tangled Up-CD-FLAC-2015-MEOWZiK-FTP/ | 2026-03-25 23:00 | - | |
| Thomas Newman/ | 2026-03-26 12:29 | - | |
| Thirty Seconds to Mars/ | 2026-04-19 18:20 | - | |
| They Might Be Giants/ | 2026-04-14 00:06 | - | |
| The_S.O.U.L._S.Y.S.T.E.M._Introducing_Michelle_Visage-Its_Gonna_Be_A_Lovely_Day-(74321_12314_2)-CDM-FLAC-1992-WRE/ | 2026-03-25 23:10 | - | |
| The Weeknd/ | 2026-04-19 19:45 | - | |
| The Waterboys/ | 2025-10-14 10:40 | - | |
| The Wanted _ Florence + the Machine/ | 2026-04-19 19:44 | - | |
| The Voice of “Nat King Cole” with the Orchestra of Gordon Jenkins/ | 2025-01-27 01:42 | - | |
| The Thrillseekers With York & Asheni/ | 2026-03-25 23:18 | - | |
| The The/ | 2026-01-18 12:54 | - | |
| The Streets/ | 2026-04-19 18:03 | - | |
| The Six Parts Seven _ The Black Keys/ | 2026-03-25 21:01 | - | |
| The Shirelles & King Curtis/ | 2026-04-19 17:00 | - | |
| The S.O.U.L. S.Y.S.T.E.M. introducing Michelle Visage/ | 2026-03-26 08:04 | - | |
| The Residents/ | 2026-01-10 04:13 | - | |
| The Rasmus/ | 2026-04-19 15:54 | - | |
| The Prodigy/ | 2026-04-19 15:35 | - | |
| The Piano Guys/ | 2025-06-01 15:46 | - | |
| The Pentangle/ | 2026-04-19 14:56 | - | |
| The Outfield & Diplo/ | 2026-03-26 08:20 | - | |
| The Orb featuring David Gilmour/ | 2026-04-19 14:23 | - | |
| The Orb/ | 2026-04-19 14:21 | - | |
| The Notorious B.I.G_/ | 2026-04-19 14:09 | - | |
| The Nitty Gritty Dirt Band/ | 2025-01-27 01:41 | - | |
| The New Basement Tapes/ | 2026-03-26 13:30 | - | |
| The Naked and Famous/ | 2026-04-19 13:38 | - | |
| The Munsters/ | 2026-03-25 02:06 | - | |
| The Moxy/ | 2026-03-25 16:15 | - | |
| The Moody Blues/ | 2026-04-19 13:14 | - | |
| The Mantovani Orchestra/ | 2026-03-26 06:07 | - | |
| The Manhattan Transfer/ | 2026-03-26 15:43 | - | |
| The Magnetic Fields/ | 2024-12-07 10:58 | - | |
| The Liminanas/ | 2026-03-26 04:13 | - | |
| The Human League/ | 2025-08-17 09:18 | - | |
| The Human League-The Very Best Of The Human League-Remastered-WEB-2003-MARR INT-FTP/ | 2026-03-26 02:13 | - | |
| The Goo Goo Dolls/ | 2026-04-19 09:25 | - | |
| The Fleetwoods/ | 2026-03-26 06:06 | - | |
| The Flaming Lips/ | 2026-04-19 08:57 | - | |
| The Fabulous Thunderbirds/ | 2026-03-25 09:12 | - | |
| The Cult/ | 2026-04-19 06:38 | - | |
| The Corrs/ | 2025-09-30 10:45 | - | |
| The Chemical Brothers feat. The Flaming Lips/ | 2026-04-19 06:18 | - | |
| The Chemical Brothers/ | 2026-04-19 06:18 | - | |
| The Charlie Daniels Band/ | 2026-01-06 15:18 | - | |
| The Chainsmokers/ | 2026-04-19 06:12 | - | |
| The Byrds/ | 2026-04-19 06:00 | - | |
| The Brand New Heavies/ | 2026-04-19 05:50 | - | |
| The Blessed Madonna feat. Clementine Douglas/ | 2026-03-25 18:01 | - | |
| The Black Mighty Orchestra/ | 2026-03-25 03:23 | - | |
| The Black Dog/ | 2026-03-25 14:44 | - | |
| The Beatles/ | 2026-04-23 00:17 | - | |
| The Beatles-Anthology 1-REMASTERED-16BIT-WEB-FLAC-2025-OBZEN-FTP/ | 2026-03-25 01:47 | - | |
| The American Dream/ | 2024-12-22 06:10 | - | |
| The All‐American Rejects/ | 2025-11-01 10:20 | - | |
| The Album Leaf/ | 2025-01-26 21:45 | - | |
| The Aaron Keylock Band/ | 2024-12-06 10:16 | - | |
| The 5th Dimension/ | 2026-02-06 05:49 | - | |
| Terror Squad feat. Fat Joe & Remy Ma/ | 2026-03-26 14:25 | - | |
| Terror Squad feat. Fat Joe & Remy/ | 2026-03-25 23:07 | - | |
| Teddy Swims/ | 2026-03-26 12:51 | - | |
| Techsonik/ | 2026-03-25 02:45 | - | |
| Taylor Swift featuring Post Malone/ | 2024-12-18 05:08 | - | |
| Taylor Swift/ | 2026-03-25 23:04 | - | |
| Taucher/ | 2026-03-26 07:13 | - | |
| Tate McRae/ | 2026-04-19 18:11 | - | |
| Tammy Wynette/ | 2025-12-31 16:49 | - | |
| Tamino/ | 2026-03-26 10:49 | - | |
| Tame Impala-Currents-2015-FLAC-24B-44.1kHz-UBi-CreW/ | 2026-03-25 05:26 | - | |
| TLC/ | 2026-04-19 18:29 | - | |
| T1One/ | 2026-03-25 19:37 | - | |
| T-Connection/ | 2026-03-26 05:04 | - | |
| Szad & Szur/ | 2026-03-25 22:58 | - | |
| Sylk 130/ | 2026-03-25 22:57 | - | |
| Switch Disco, R3HAB, Sam Feldt/ | 2026-03-25 22:56 | - | |
| Switch Disco, Charlotte Haining & FELIX/ | 2026-03-25 22:56 | - | |
| Swedish House Mafia & Alicia Keys/ | 2026-04-19 18:06 | - | |
| Suzanne Vega/ | 2026-04-19 18:06 | - | |
| Susana/ | 2026-03-26 15:22 | - | |
| Summer Walker/ | 2026-04-19 18:05 | - | |
| Sugababes/ | 2026-04-19 18:05 | - | |
| Subtil/ | 2026-03-25 14:02 | - | |
| Sub Focus, Katy B/ | 2026-04-19 18:04 | - | |
| Sub Focus & Katy B/ | 2026-03-25 18:52 | - | |
| Stu Infinity/ | 2026-03-25 22:48 | - | |
| Stoy1tek/ | 2026-03-25 22:45 | - | |
| Sting/ | 2026-02-21 04:23 | - | |
| Stick Figure/ | 2026-04-19 18:01 | - | |
| Steve Martin/ | 2026-03-26 12:13 | - | |
| Steve Martin & Edie Brickell/ | 2026-03-26 12:51 | - | |
| Steve Earle and The Del McCoury Band/ | 2024-12-18 05:08 | - | |
| Steve Earle/ | 2025-01-26 21:40 | - | |
| Steve Aoki & David Guetta ft. Swae Lee, PnB Rock & KABU/ | 2026-03-26 04:24 | - | |
| Stephen King/ | 2026-03-26 10:38 | - | |
| Stelvio Cipriani/ | 2026-03-26 08:19 | - | |
| Steen Thottrup/ | 2026-03-26 14:03 | - | |
| Staind/ | 2026-04-19 17:57 | - | |
| Squeeze/ | 2026-03-26 10:21 | - | |
| Soundtrack/ | 2026-03-26 09:56 | - | |
| Sound of Legend/ | 2026-03-26 06:56 | - | |
| Soul II Soul/ | 2026-04-19 17:22 | - | |
| Soul Asylum/ | 2026-01-12 06:03 | - | |
| Sophie Ellis-Bextor/ | 2026-04-19 17:19 | - | |
| Sophie Ellis-Bextor & Themba/ | 2026-04-19 17:20 | - | |
| Sonny Fodera ft. blythe/ | 2026-03-26 13:10 | - | |
| Sonny Fodera, Jazzy & D.O.D/ | 2026-03-26 05:35 | - | |
| Sonny Boy Williamson/ | 2026-03-26 04:31 | - | |
| Sonicwonder/ | 2026-03-25 21:11 | - | |
| Sonic Dream Collective/ | 2026-03-26 08:22 | - | |
| Sol Goichberg & Max Goberman/ | 2026-03-25 13:48 | - | |
| Snow Patrol/ | 2025-03-16 19:04 | - | |
| Snoop Dogg/ | 2026-04-19 17:14 | - | |
| Snoop Dogg & Dr. Dre/ | 2026-03-25 21:08 | - | |
| Snap!/ | 2026-03-26 10:40 | - | |
| Sly & the Family Stone/ | 2025-08-28 08:06 | - | |
| Slipknot/ | 2026-03-02 10:04 | - | |
| Sleep Token-Even In Arcadia-SICP-6703-JP RETAIL-CD-FLAC-2025-FAiNT/ | 2026-03-25 09:01 | - | |
| Sleep Token-Even In Arcadia-24BIT-WEB-FLAC-2025-TiMES/ | 2026-03-25 21:06 | - | |
| Slave/ | 2026-03-26 13:35 | - | |
| Skrillex/ | 2026-04-19 17:09 | - | |
| Skillet/ | 2026-04-19 17:09 | - | |
| Sizzla Kalonji/ | 2024-12-07 17:24 | - | |
| Sizzla/ | 2025-06-01 11:25 | - | |
| Sizzla-Red Alert-CRLP3093-LP-FLAC-2003-YARD-FTP/ | 2026-03-25 19:14 | - | |
| Sister Sledge/ | 2026-03-26 09:00 | - | |
| Sistek feat. Karol G/ | 2026-03-25 18:49 | - | |
| Sio, Atmos Blaq/ | 2026-03-25 20:59 | - | |
| Sinead O'Connor/ | 2026-04-19 17:02 | - | |
| Sinéad O’Connor/ | 2026-04-19 17:04 | - | |
| Simple Minds-Once Upon A Time-Remastered-24BIT-96KHZ-WEB-FLAC-2025-TiMES/ | 2026-03-25 20:55 | - | |
| Silk Department/ | 2026-03-25 20:53 | - | |
| Sigala/ | 2026-03-26 04:13 | - | |
| Sia/ | 2026-04-19 17:00 | - | |
| Sheryl Crow/ | 2025-07-17 05:59 | - | |
| Sheryl Crow & Surf Mesa/ | 2026-04-19 17:00 | - | |
| Sharon Van Etten & The Attachment Theory/ | 2026-03-25 20:47 | - | |
| Shane Codd/ | 2026-03-26 13:27 | - | |
| Shane Codd, Raphaella & Manovski/ | 2026-03-26 10:26 | - | |
| Shaboozey/ | 2026-03-26 10:52 | - | |
| Shaboozey & David Guetta/ | 2026-03-26 04:12 | - | |
| Sevdaliza, Pabllo Vittar & Yseult/ | 2026-03-26 07:32 | - | |
| September/ | 2026-04-19 16:56 | - | |
| Selena Gomez & benny blanco/ | 2026-04-19 16:55 | - | |
| Scooter/ | 2026-04-19 16:52 | - | |
| Scissor Sisters-Laura-Promo CDS-2004-ERP-FTP/ | 2026-03-25 13:59 | - | |
| Scissor Sisters-Laura-Promo-CDS-FLAC-2004-ERP-FTP/ | 2026-03-25 14:00 | - | |
| Scarface/ | 2026-03-26 07:53 | - | |
| Scarface-The.Fix-[16BIT]-[WEBFLAC]-[2002]-TDS/ | 2026-03-25 20:29 | - | |
| Scarface-The.Fix-[16BIT]-[WEBFLAC]-[2002]-TDS - Copy/ | 2026-03-26 13:23 | - | |
| Saya Gray/ | 2026-03-25 20:28 | - | |
| Satie; Jean‐Yves Thibaudet/ | 2025-01-27 01:41 | - | |
| Sarah Brightman/ | 2026-04-19 16:48 | - | |
| Sarah Brightman & Andrea Bocelli/ | 2026-04-19 16:49 | - | |
| Sandra/ | 2026-04-19 16:46 | - | |
| Sammy Virji/ | 2026-03-25 20:21 | - | |
| Sam Spiegel, Sia & Tropkillaz/ | 2026-03-26 12:24 | - | |
| Sam Smith/ | 2026-04-19 16:43 | - | |
| Sam L. Jones/ | 2026-03-25 20:18 | - | |
| Sam Fender/ | 2026-03-26 03:54 | - | |
| Sabrina Carpenter/ | 2026-04-19 16:41 | - | |
| Sabrina Carpenter & Mark Ronson/ | 2026-04-19 16:41 | - | |
| SZA/ | 2026-04-19 18:09 | - | |
| STARZ ANGELS feat PUSSYCAT DOLLS/ | 2026-03-25 08:20 | - | |
| SHAED/ | 2026-03-25 09:01 | - | |
| S3RL/ | 2026-03-26 15:12 | - | |
| Sébastien Tellier/ | 2026-03-26 13:41 | - | |
| Rush-Rush 50-Anniversary Super Deluxe Edition-2025-16bit 44.1khz-FLAC/ | 2026-03-25 20:11 | - | |
| Rudimental x Karen Harding/ | 2026-04-19 16:39 | - | |
| Rudimental/ | 2026-04-19 16:38 | - | |
| Rudimental, Skepsis, Charlotte Plank & Riko Dan/ | 2026-04-19 16:38 | - | |
| Royksopp/ | 2026-04-19 16:36 | - | |
| Roy Orbison/ | 2026-03-25 20:03 | - | |
| Roxette/ | 2026-04-19 16:35 | - | |
| Rose Royce & Chic/ | 2026-04-19 16:35 | - | |
| Rory Northall/ | 2026-03-25 20:01 | - | |
| Ronnie Milsap/ | 2024-12-07 16:23 | - | |
| Ronald Jenkees/ | 2026-03-26 12:31 | - | |
| Ron Hagen & Pascal M/ | 2026-03-25 01:54 | - | |
| Rodney Crowell/ | 2024-12-07 16:41 | - | |
| Roddy Ricch/ | 2026-04-19 16:30 | - | |
| Roc Marciano-Marcberg-15th Anniversary Edition-24BIT-WEB-FLAC-2025-TiMES-FTP/ | 2026-03-25 14:56 | - | |
| Robyn Miller/ | 2026-03-25 19:55 | - | |
| Robin Trower featuring Sari Schorr/ | 2026-03-26 12:36 | - | |
| Robin Trower/ | 2026-03-26 12:00 | - | |
| Robin Trower & Jack Bruce/ | 2026-03-26 15:24 | - | |
| Robin Thicke/ | 2026-04-19 16:25 | - | |
| Robin Schulz feat. Alida/ | 2026-03-25 19:36 | - | |
| Roberto Sol/ | 2026-03-25 19:48 | - | |
| Robert Duvall/ | 2026-03-25 05:21 | - | |
| Rob Simonsen/ | 2026-03-26 12:52 | - | |
| Rita Ora x David Guetta x Imanbek Maratuly Zeikenov feat. Gunna/ | 2026-03-25 19:46 | - | |
| Rita Ora/ | 2026-03-25 02:03 | - | |
| Riot V/ | 2026-04-19 16:21 | - | |
| Riot/ | 2026-04-19 16:21 | - | |
| Ricky Martin/ | 2026-01-02 20:36 | - | |
| Rick Ross/ | 2025-07-04 08:10 | - | |
| Rick Ross-Ashes To Ashes-(Bootleg)-2010-H3X/ | 2026-03-25 02:03 | - | |
| Rick Astley/ | 2026-04-19 16:18 | - | |
| Richi M/ | 2026-03-26 11:56 | - | |
| Richard Thompson/ | 2025-06-07 15:38 | - | |
| Richard Marx/ | 2026-04-19 16:10 | - | |
| Richard Clayderman/ | 2026-02-22 14:07 | - | |
| Richard Clayderman & Royal Philharmonic Orchestra/ | 2024-12-18 05:08 | - | |
| Reno Wurzbacher/ | 2026-03-25 19:28 | - | |
| Rema/ | 2026-03-25 19:18 | - | |
| Reinhard Goebel/ | 2026-03-26 08:45 | - | |
| Reese/ | 2026-03-26 05:16 | - | |
| Reba McEntire/ | 2026-03-23 00:09 | - | |
| Reba/ | 2025-01-26 21:12 | - | |
| Real McCoy/ | 2026-04-19 15:59 | - | |
| Raymond Leppard/ | 2026-03-25 13:48 | - | |
| Raymond Lefevre/ | 2026-03-26 12:13 | - | |
| Ray J/ | 2026-03-26 14:25 | - | |
| Ravin & David Visan/ | 2026-04-19 15:57 | - | |
| Raveena/ | 2026-03-26 07:29 | - | |
| Ratos de Porao/ | 2026-04-19 15:57 | - | |
| Randy Travis/ | 2026-04-19 15:51 | - | |
| Randall King/ | 2026-03-25 18:59 | - | |
| Rancid/ | 2026-04-19 15:49 | - | |
| Ramsey Lewis/ | 2026-03-26 07:33 | - | |
| Ralph MacDonald/ | 2026-03-26 07:28 | - | |
| Ralph Burns/ | 2026-03-25 16:48 | - | |
| Rage Against the Machine/ | 2025-10-14 10:44 | - | |
| Rage/ | 2026-04-19 15:48 | - | |
| Rag'n'Bone Man/ | 2026-04-19 15:48 | - | |
| Radiohead/ | 2026-04-19 15:47 | - | |
| Rachel Taylor/ | 2026-03-25 18:55 | - | |
| RUFUS DU SOL/ | 2026-03-26 04:18 | - | |
| RIIZE/ | 2026-03-26 05:11 | - | |
| R. Kelly/ | 2026-02-08 02:40 | - | |
| R.E.M_/ | 2024-12-07 17:28 | - | |
| R.E.M/ | 2026-01-10 07:50 | - | |
| Röyksopp/ | 2026-04-19 16:36 | - | |
| Quincy Jones/ | 2026-02-19 01:36 | - | |
| Quiet Riot/ | 2025-12-31 15:16 | - | |
| Purple Disco Machine/ | 2026-03-26 13:07 | - | |
| Public Enemy featuring Paris/ | 2025-01-27 01:41 | - | |
| Public Enemy/ | 2026-01-18 19:41 | - | |
| Prospa feat. RAHH/ | 2026-03-25 18:48 | - | |
| Probspot/ | 2026-03-26 08:40 | - | |
| Prince and The New Power Generation/ | 2024-12-11 08:39 | - | |
| Prince/ | 2026-01-02 18:27 | - | |
| Prince-Prince.1979.Funk.[Flac.24-192]/ | 2026-03-25 18:42 | - | |
| Pretty Lights/ | 2026-03-26 14:34 | - | |
| Powfu/ | 2026-03-26 08:01 | - | |
| Power-Pill/ | 2026-03-25 18:35 | - | |
| Pop Will Eat Itself/ | 2026-03-26 08:21 | - | |
| Pony Pony Run Run & Bormin'/ | 2026-03-25 11:11 | - | |
| Polo & Pan/ | 2026-03-26 06:50 | - | |
| Poison/ | 2026-04-19 15:22 | - | |
| Planxty/ | 2026-04-19 15:19 | - | |
| Planetshakers/ | 2026-04-19 15:18 | - | |
| Planetary Assault Systems/ | 2025-06-29 16:49 | - | |
| Placebo/ | 2026-04-19 15:18 | - | |
| Pitbull & Bon Jovi/ | 2026-03-25 17:12 | - | |
| Pinkard & Bowden/ | 2026-03-25 18:15 | - | |
| PinkPantheress/ | 2026-04-19 15:09 | - | |
| Pimp C/ | 2026-03-26 13:41 | - | |
| Philarmonia Strings Orchestra/ | 2026-03-25 18:13 | - | |
| Phil_Collins_-_In_The_Air_Tonight_('88_Remix)_(1988)_[CDM]_FLAC/ | 2026-03-25 18:12 | - | |
| Phil Collins/ | 2026-04-19 15:01 | - | |
| Pheek/ | 2026-03-25 18:11 | - | |
| Peter White/ | 2026-03-26 08:37 | - | |
| Peter Hagerstrand/ | 2026-03-25 18:09 | - | |
| Peter Doherty/ | 2026-03-26 11:11 | - | |
| Pete Tong x RoRo x Jules Buckley & The Essential Orchestra/ | 2026-03-25 18:08 | - | |
| Perrie/ | 2026-03-26 11:08 | - | |
| Perfume Genius/ | 2026-04-19 14:57 | - | |
| Percy Faith/ | 2026-03-26 14:10 | - | |
| Pavement/ | 2026-02-06 22:56 | - | |
| Paul van Dyk/ | 2026-04-24 16:09 | - | |
| Paula Abdul/ | 2026-04-19 14:53 | - | |
| Paul Weller/ | 2026-04-19 14:45 | - | |
| Paul Russell/ | 2026-03-25 17:54 | - | |
| Paul Oakenfold/ | 2026-03-25 17:53 | - | |
| Paul Johnson _ Armando/ | 2026-03-26 05:38 | - | |
| Paul J. Smith/ | 2026-03-25 17:52 | - | |
| Paul Hardcastle/ | 2026-02-08 02:36 | - | |
| Paul Hardcastle & Ryan Farish/ | 2025-01-27 01:41 | - | |
| Paul Hardcastle & Becki Biggins/ | 2025-01-27 01:42 | - | |
| Patty Loveless/ | 2025-01-26 23:05 | - | |
| Patricia Barber/ | 2026-04-19 14:38 | - | |
| Pat Benatar/ | 2025-02-25 00:25 | - | |
| Parcels/ | 2026-04-19 14:35 | - | |
| Panda Bear/ | 2026-03-26 13:31 | - | |
| PNAU x Coldplay/ | 2026-03-26 13:45 | - | |
| PJ Harvey/ | 2026-04-19 15:10 | - | |
| PJ Harvey & John Parish/ | 2026-04-19 15:18 | - | |
| PAWSA/ | 2026-03-25 18:04 | - | |
| PAWSA & Adventures of Stevie V/ | 2026-03-25 18:05 | - | |
| PARTYNEXTDOOR & Drake/ | 2026-03-26 08:40 | - | |
| P.O.D_/ | 2025-01-26 22:58 | - | |
| P.O.D/ | 2026-02-19 01:34 | - | |
| P. Morris/ | 2026-03-25 17:39 | - | |
| P!nk/ | 2026-04-19 14:31 | - | |
| Ovnimoon-Magnetic Portal-16BIT-WEB-FLAC-2012-FALCON-FTP/ | 2026-03-25 14:42 | - | |
| Ovnimoon-Family Of Light-16BIT-WEB-FLAC-2009-FALCON-FTP/ | 2026-03-25 09:14 | - | |
| Orinoko/ | 2026-03-25 17:38 | - | |
| Orbital/ | 2026-04-19 14:24 | - | |
| Orbital-Radiccio-WEB-2025-BB/ | 2026-03-25 17:37 | - | |
| Orbital-Midnight Choice-REMASTERED-16BIT-WEB-FLAC-2024-ENRiCH/ | 2026-03-25 17:37 | - | |
| Orbital-Midnight Choice-REMASTERED-16BIT-WEB-FLAC-2024-ENRiCH - Copy/ | 2026-04-19 14:27 | - | |
| Orbital-III-REMASTERED-16BIT-WEB-FLAC-2024-ENRiCH/ | 2026-03-25 17:37 | - | |
| Orbital-III-REMASTERED-16BIT-WEB-FLAC-2024-ENRiCH - Copy/ | 2026-04-19 14:27 | - | |
| Orb/ | 2026-04-19 14:21 | - | |
| Opeth/ | 2026-04-19 14:21 | - | |
| Operation Ivy/ | 2026-03-26 06:27 | - | |
| Opcio K-95/ | 2026-03-25 17:27 | - | |
| One Direction/ | 2026-04-19 14:16 | - | |
| Omarion/ | 2026-03-26 08:13 | - | |
| Omarion-O-[24BIT]-[WEBFLAC]-[2005]-TDS/ | 2026-03-25 17:22 | - | |
| Omarion-O-[24BIT]-[WEBFLAC]-[2005]-TDS - Copy/ | 2026-03-26 13:16 | - | |
| Olly Alexander/ | 2026-03-26 12:11 | - | |
| Olivier Mellano/ | 2026-03-25 17:20 | - | |
| Olivia Newton-John/ | 2026-03-26 11:20 | - | |
| Olivia Newton‐John/ | 2026-03-26 12:21 | - | |
| Oklou/ | 2026-03-26 07:40 | - | |
| Ofenbach & salem ilese/ | 2026-04-19 14:12 | - | |
| Ofenbach & Justin Jesso/ | 2026-04-19 14:12 | - | |
| Obscure Shape/ | 2026-03-25 02:46 | - | |
| Obie Trice/ | 2026-04-19 14:11 | - | |
| OMC/ | 2026-03-26 05:12 | - | |
| Nora en Pure & Lika Morgan/ | 2026-03-26 06:00 | - | |
| Nora Roberts/ | 2026-03-25 17:10 | - | |
| Nonpoint/ | 2026-03-26 05:14 | - | |
| Nitty Gritty Dirt Band/ | 2026-01-18 19:46 | - | |
| Nitty/ | 2026-03-25 17:07 | - | |
| Nicolette Larson/ | 2026-03-26 07:26 | - | |
| Nicolas Errera/ | 2026-03-25 17:04 | - | |
| Nick Ward/ | 2026-03-25 20:51 | - | |
| NewEra/ | 2026-03-25 16:57 | - | |
| Nelly Furtado/ | 2026-04-19 13:50 | - | |
| Nelly Furtado & DJ Arana/ | 2026-03-25 05:14 | - | |
| Nelly Furtado & Adana Twins/ | 2026-03-25 20:27 | - | |
| Neja/ | 2026-04-19 13:50 | - | |
| Neil Diamond & Two Friends/ | 2026-03-25 22:56 | - | |
| Nea/ | 2026-03-25 16:51 | - | |
| Ne-Yo/ | 2026-04-19 13:53 | - | |
| Ne‐Yo/ | 2026-04-19 13:53 | - | |
| Nathaniel Mechaly/ | 2026-03-25 16:47 | - | |
| Nathan Dawe x Abi Flynn/ | 2026-03-25 16:47 | - | |
| Nathan Dawe, Joel Corry & SACHA/ | 2026-03-26 13:30 | - | |
| Natalie Taylor/ | 2026-03-26 08:02 | - | |
| Natalie Merchant/ | 2026-01-27 00:27 | - | |
| Nat King Cole/ | 2025-01-26 20:40 | - | |
| Nat ‘King’ Cole/ | 2025-01-26 23:08 | - | |
| Nas/ | 2026-04-19 13:41 | - | |
| Nas & Jay‐Z/ | 2026-03-25 16:45 | - | |
| Nas & JAY-Z/ | 2026-04-19 13:41 | - | |
| Naomi Sharon/ | 2026-04-19 13:41 | - | |
| Nancy Sinatra/ | 2026-03-25 16:42 | - | |
| Nancy Sinatra - The Essential Nancy Sinatra/ | 2026-03-25 16:42 | - | |
| Nancy Sinatra - The Essential Nancy Sinatra - Copy/ | 2026-03-26 11:04 | - | |
| Nancy Sinatra & Lee Hazlewood/ | 2025-01-27 01:41 | - | |
| Nadia Ali-Rapture-ZOUK043-WEB-2010-TraX/ | 2026-03-25 19:04 | - | |
| Nadia Ali-Queen Of Clubs Trilogy Ruby Edition-WEB-2010-PWT/ | 2026-03-25 18:53 | - | |
| NY STOMP/ | 2026-03-25 17:14 | - | |
| NOSI/ | 2026-03-25 17:11 | - | |
| NOFX vs. Frank Turner/ | 2024-12-11 04:05 | - | |
| NOFX/ | 2026-04-22 10:38 | - | |
| NO F-X/ | 2024-12-11 04:04 | - | |
| NO F‐X/ | 2025-01-27 01:42 | - | |
| NEEDTOBREATHE/ | 2026-04-19 13:49 | - | |
| Mylene Farmer/ | 2024-12-07 17:13 | - | |
| Mylène Farmer/ | 2026-02-21 19:21 | - | |
| My Chemical Romance/ | 2026-04-19 13:33 | - | |
| Mutya Buena/ | 2026-04-19 13:33 | - | |
| Mustafa Cihan/ | 2026-03-25 09:56 | - | |
| Muslimgauze/ | 2026-03-26 07:56 | - | |
| Murs/ | 2026-03-26 08:46 | - | |
| Murs & El Lif Beatz/ | 2026-03-26 05:05 | - | |
| Muni Long/ | 2026-04-19 13:25 | - | |
| Muni Long & HUGEL/ | 2026-03-25 14:40 | - | |
| Muddy Monk/ | 2026-03-25 16:24 | - | |
| Ms. Dynamite/ | 2026-03-26 13:08 | - | |
| Mr. Big/ | 2026-01-12 01:05 | - | |
| Mr. Belt & Wezol/ | 2026-03-25 16:22 | - | |
| Mozart; Thomas Allen, Carol Vaness, Maria Ewing, Elizabeth Gale, Keith Lewis, Richard van Allan, John Rawnsley, Dmitri Kavrakos, Glyndebourne Chorus, London Philharmonic Orchestra, Bernard Haitink/ | 2026-03-25 16:22 | - | |
| Mozart; Royal Philharmonic Orchestra, Jane Glover/ | 2026-03-25 16:21 | - | |
| Mozart; Noordhollands Jongenskoor and Koorscholl of the _Grote of St. Laurenskerk_, Alkmaar, Holland, Hendrik Timmerman, Rob Petri, Jan Brink, Robert Overpelt, Gerard Rooker/ | 2026-03-25 16:21 | - | |
| Mozart; Gottlieb Wallisch/ | 2026-03-25 16:20 | - | |
| Mozart; Antony Pay, Michel Piguet, Academy of Ancient Music, Christopher Hogwood/ | 2026-03-25 16:20 | - | |
| Mozart; Anna Tomowa‐Sintow, Helga Müller‐Molinari, Vinson Cole, Paata Burchuladze, Wiener Singverein, Wiener Philharmoniker, Herbert von Karajan/ | 2026-03-25 16:17 | - | |
| Mozart/ | 2026-03-25 16:16 | - | |
| Move D/ | 2026-03-25 16:14 | - | |
| Motorhead/ | 2026-04-19 13:16 | - | |
| Motoi Sakuraba/ | 2026-03-26 15:16 | - | |
| Motionless in White/ | 2026-04-19 13:16 | - | |
| Motörhead/ | 2026-04-19 13:20 | - | |
| Morusque/ | 2026-03-25 16:04 | - | |
| Morgan Seatree feat. Florence + the Machine/ | 2026-03-25 16:03 | - | |
| Moniker/ | 2026-03-25 16:01 | - | |
| Moby/ | 2026-04-19 13:12 | - | |
| MitiS/ | 2026-03-25 15:59 | - | |
| Miracle of Sound/ | 2026-03-26 13:23 | - | |
| Milt Jackson with Hubert Laws/ | 2026-03-26 08:50 | - | |
| Milt Jackson/ | 2026-03-26 03:31 | - | |
| Miley Cyrus/ | 2026-04-19 13:10 | - | |
| Mike Posner & Lincoln Jesser/ | 2026-03-25 02:49 | - | |
| Midnight Oil/ | 2025-08-28 08:32 | - | |
| Mick Gordon/ | 2026-03-26 08:46 | - | |
| Michel Magne/ | 2026-03-26 10:28 | - | |
| Michel Benita featuring Manu Codjia/ | 2026-03-25 15:49 | - | |
| Michael Schenker/ | 2026-03-26 05:17 | - | |
| Michael Mansion/ | 2026-03-25 15:47 | - | |
| Michael Kiwanuka/ | 2026-04-19 13:05 | - | |
| Michael Kamen/ | 2026-03-26 07:39 | - | |
| Michael Giacchino/ | 2026-03-26 12:14 | - | |
| Michael E & Tim Gelo/ | 2026-03-25 15:44 | - | |
| Michael Bublé/ | 2025-01-26 23:09 | - | |
| Michael Bublé & Carly Pearce/ | 2025-01-27 01:41 | - | |
| Mflex Sounds/ | 2026-03-25 15:43 | - | |
| Methodub/ | 2026-03-25 02:46 | - | |
| Method Man presents... Street Life/ | 2026-04-19 13:00 | - | |
| Method Man/ | 2026-04-19 13:00 | - | |
| Men at Work/ | 2026-04-19 12:59 | - | |
| Men I Trust/ | 2026-03-26 13:17 | - | |
| Melodie MC/ | 2026-03-26 11:52 | - | |
| Melissa Manchester/ | 2026-03-26 04:57 | - | |
| Melissa Etheridge/ | 2026-02-22 13:49 | - | |
| Melanie Pfirrman/ | 2026-03-25 17:18 | - | |
| Meghan Trainor & Chromeo/ | 2026-03-25 05:21 | - | |
| McAlmont & Butler/ | 2026-03-26 14:42 | - | |
| Max Richter/ | 2026-03-26 07:34 | - | |
| Max Richter-Sleep Circle-2025-24-96/ | 2026-03-25 21:05 | - | |
| Max Goberman, Sol Goichberg & Mary Zelnicki/ | 2026-03-25 13:49 | - | |
| Mau P/ | 2026-03-25 15:30 | - | |
| Matt Sassari & HUGEL/ | 2026-03-25 15:28 | - | |
| Matsutani Suguru/ | 2026-03-25 15:27 | - | |
| Mats Gustafsson _ Tony Lugo/ | 2026-03-25 15:25 | - | |
| Mats Gustafsson, Craig Taborn/ | 2026-03-25 15:26 | - | |
| Matrix/ | 2026-03-25 15:24 | - | |
| Mastodon/ | 2026-04-19 12:48 | - | |
| Mase/ | 2026-03-26 08:13 | - | |
| Mary J. Blige/ | 2026-04-19 12:42 | - | |
| Martina McBride/ | 2026-04-24 22:13 | - | |
| Martin O'Donnell and Michael Salvatori/ | 2026-03-25 15:03 | - | |
| Martin O’Donnell and Michael Salvatori/ | 2026-03-25 15:03 | - | |
| Martial Solal/ | 2026-03-26 07:52 | - | |
| Marshmello & Kane Brown/ | 2026-04-19 12:40 | - | |
| Markus Schulz Vs Ferry Corsten X Omnia/ | 2026-03-25 14:28 | - | |
| Markus Schulz/ | 2026-04-19 12:38 | - | |
| Markus Schulz, Ferry Corsten & Omnia/ | 2026-03-25 15:01 | - | |
| Markus Masuhr/ | 2026-03-25 15:00 | - | |
| Mariah Carey/ | 2026-04-19 12:36 | - | |
| Mariah Carey-The Emancipation Of Mimi-20th Anniversary Edition-2CD-2025-FLAC-16Bit-Sc4r3cr0w/ | 2026-03-25 08:37 | - | |
| Marcus Anderson/ | 2026-03-25 14:58 | - | |
| Marco V vs. Jens/ | 2026-03-26 04:49 | - | |
| Marco Beltrami/ | 2026-03-26 14:06 | - | |
| Marcelo Zarvos/ | 2026-03-26 10:26 | - | |
| Marc Hartman/ | 2026-03-26 11:02 | - | |
| Mando Diao/ | 2026-04-19 12:31 | - | |
| Maluma feat. Nego do Borel/ | 2026-04-19 12:30 | - | |
| Malcom Kipe/ | 2026-03-25 14:45 | - | |
| Makoto Tomozawa, Sayaka Fujita & Akari Kaida/ | 2026-03-25 14:43 | - | |
| Maisy Kay & Tiesto/ | 2026-03-25 14:42 | - | |
| Madonna/ | 2026-04-19 12:26 | - | |
| Madeleine Peyroux/ | 2026-04-19 12:25 | - | |
| Macy Gray/ | 2025-01-26 23:16 | - | |
| Maître Gims/ | 2026-04-19 12:28 | - | |
| MTZR/ | 2026-03-25 14:01 | - | |
| MOD, Myrra Malmberg & Orphei Drangar/ | 2026-03-25 16:00 | - | |
| MC Lyte/ | 2026-04-19 12:54 | - | |
| MARINA/ | 2026-04-19 12:37 | - | |
| M.O.D_/ | 2026-03-25 14:40 | - | |
| Luther Vandross/ | 2026-04-19 12:14 | - | |
| Luis Bacalov/ | 2026-03-26 15:39 | - | |
| Ludwig van Beethoven; Maurizio Pollini/ | 2024-12-18 05:07 | - | |
| Ludwig van Beethoven/ | 2025-06-05 09:14 | - | |
| Ludovico Einaudi/ | 2026-03-26 08:09 | - | |
| Ludacris-Release Therapy-JP Retail-CD-FLAC-2006-CALiFLAC-FTP/ | 2026-03-25 19:18 | - | |
| Lucy Dacus/ | 2026-04-19 12:07 | - | |
| Lucinda Williams/ | 2026-01-22 05:49 | - | |
| Luca Testa; Emison/ | 2026-03-25 14:31 | - | |
| Love & The Outcome/ | 2026-04-19 12:05 | - | |
| Lost Radiance/ | 2026-03-25 14:30 | - | |
| Lost Frequencies/ | 2026-04-19 12:01 | - | |
| Lost Frequencies & Tom Odell/ | 2026-03-25 14:30 | - | |
| Lost Frequencies & Bomfunk MC's/ | 2026-04-19 12:01 | - | |
| Loopspool/ | 2026-03-25 14:28 | - | |
| London Philharmonic Orchestra/ | 2026-03-26 15:19 | - | |
| London Grammar/ | 2026-04-19 11:58 | - | |
| London Bus Stop/ | 2026-03-26 08:02 | - | |
| Logic/ | 2026-04-19 11:55 | - | |
| Living Room, Worldtraveller & Pearldiver/ | 2026-03-25 14:21 | - | |
| Little Big Town/ | 2025-03-04 04:58 | - | |
| Lisa Stansfield/ | 2026-04-19 11:50 | - | |
| Linkin Park/ | 2026-04-19 11:48 | - | |
| Lil Wayne/ | 2026-04-19 11:47 | - | |
| Lil Nas X/ | 2026-04-19 11:47 | - | |
| Lifeformed/ | 2026-03-25 14:12 | - | |
| Lescop/ | 2026-03-26 13:48 | - | |
| Les Rita Mitsouko/ | 2026-04-19 11:45 | - | |
| Leona Lewis/ | 2026-04-19 11:44 | - | |
| Lenny Kravitz/ | 2026-04-26 06:25 | - | |
| Lenny Kravitz & Jamie Jones/ | 2026-04-19 11:44 | - | |
| Lemongrass/ | 2026-03-26 06:48 | - | |
| Lavern & Dezko/ | 2026-03-25 11:38 | - | |
| Laura Pausini/ | 2026-03-01 17:04 | - | |
| Laura Branigan/ | 2025-02-15 20:41 | - | |
| Lara Fabian/ | 2025-12-31 03:22 | - | |
| Lange/ | 2026-03-26 14:39 | - | |
| Lance Lopez/ | 2026-03-25 13:58 | - | |
| Lana Del Rey/ | 2026-04-19 11:34 | - | |
| Lady Saw/ | 2026-03-26 03:51 | - | |
| Lady Gaga/ | 2026-04-19 11:31 | - | |
| Lady Gaga-The Fame Monster (Deluxe Edition)-PROPER-2CD-2009-DOH/ | 2026-03-25 09:13 | - | |
| Lady Gaga & Bruno Mars/ | 2026-04-19 11:32 | - | |
| Lady GaGa-The Fame-Japan Retail-CD-FLAC-2009-PERFECT/ | 2026-03-25 13:56 | - | |
| LISA feat. Doja Cat & RAYE/ | 2026-04-19 11:49 | - | |
| LISA/ | 2026-04-19 11:49 | - | |
| Kym Sims/ | 2026-04-19 11:31 | - | |
| Kylie Minogue with Bebe Rexha & Tove Lo/ | 2026-04-19 11:31 | - | |
| Kygo w_ OneRepublic/ | 2026-04-19 11:30 | - | |
| Kygo, Imagine Dragons & Zerb/ | 2026-04-19 11:30 | - | |
| Kygo & Imagine Dragons/ | 2026-04-19 11:29 | - | |
| Kx5 feat. Hayla/ | 2026-03-25 13:51 | - | |
| Kris Kross Amsterdam & Inna/ | 2026-03-26 05:12 | - | |
| Kris Kristofferson/ | 2025-12-31 02:52 | - | |
| Kris Kristofferson & Rita Coolidge/ | 2024-12-18 05:07 | - | |
| Kris & Rita/ | 2024-12-18 05:08 | - | |
| Krimma/ | 2026-03-25 11:10 | - | |
| Krept & Konan/ | 2026-03-26 08:39 | - | |
| Kraftwerk/ | 2026-04-19 11:24 | - | |
| Kottonmouth Kings-The Green Album-Deluxe Edition-16BIT-WEB-FLAC-2008-VEXED-FTP/ | 2026-03-25 10:34 | - | |
| Kottonmouth Kings-Sunrise Sessions-16BIT-WEB-FLAC-2011-VEXED/ | 2026-03-25 13:43 | - | |
| Korn/ | 2026-04-19 11:22 | - | |
| Kool & the Gang/ | 2026-04-19 11:22 | - | |
| Konrad Elfers/ | 2026-03-25 13:40 | - | |
| Klo Pelgag/ | 2026-04-19 11:20 | - | |
| Kirwan/ | 2026-03-25 13:37 | - | |
| Killswitch Engage/ | 2026-04-19 11:19 | - | |
| Kid Cudi/ | 2026-03-26 04:17 | - | |
| Khia/ | 2026-03-26 11:50 | - | |
| Kevin Penkin/ | 2026-03-26 10:46 | - | |
| Kevin MacLeod/ | 2026-03-26 04:37 | - | |
| Kev Tecknoboy/ | 2026-03-25 13:32 | - | |
| Kesha/ | 2026-04-19 11:15 | - | |
| Kenzie, aespa, NCT DREAM, RIIZE/ | 2026-03-25 13:30 | - | |
| Kenny Rogers & VAVO/ | 2026-03-25 09:58 | - | |
| Kenny G/ | 2026-04-19 11:12 | - | |
| Kenny G & Rahul Sharma/ | 2026-04-19 11:14 | - | |
| Kenny Chesney/ | 2026-04-19 11:11 | - | |
| Kelly Clarkson/ | 2026-04-19 11:11 | - | |
| Kelis feat. Too $hort/ | 2026-04-19 11:11 | - | |
| Kelis/ | 2026-04-19 11:10 | - | |
| Keira Green; Lost Boys from Ibiza/ | 2026-03-25 13:23 | - | |
| Keegan DeWitt/ | 2026-03-26 05:04 | - | |
| Katy Perry/ | 2025-09-09 23:45 | - | |
| Katy Hudson/ | 2025-01-26 23:09 | - | |
| Katie Melua/ | 2025-01-26 23:25 | - | |
| Karl Richter/ | 2026-03-26 14:43 | - | |
| Karfagen/ | 2024-12-07 17:19 | - | |
| Karate/ | 2026-03-26 12:15 | - | |
| Kane Brown/ | 2026-04-19 11:06 | - | |
| Kali Uchis/ | 2026-04-19 11:05 | - | |
| Kali Uchis-Sincerely-CD-FLAC-2025-PERFECT/ | 2026-03-25 12:58 | - | |
| Kaiser Chiefs/ | 2026-04-19 11:03 | - | |
| Kadington/ | 2026-03-25 12:54 | - | |
| KREAM feat. Jem Cooke/ | 2026-03-25 13:49 | - | |
| KMFDM/ | 2026-01-28 13:01 | - | |
| KISS/ | 2026-04-19 11:19 | - | |
| K-Klass/ | 2026-03-26 03:58 | - | |
| K‐Klass/ | 2026-03-26 03:36 | - | |
| Justin Timberlake/ | 2026-04-19 11:01 | - | |
| Justin Timberlake & Christina Aguilera/ | 2026-04-19 11:01 | - | |
| Justin & Christina/ | 2026-03-25 12:51 | - | |
| Justice/ | 2026-04-19 11:00 | - | |
| Juno Reactor/ | 2025-11-05 11:04 | - | |
| Juno Reactor & GMS/ | 2024-12-11 04:05 | - | |
| Jungle Brothers/ | 2026-03-26 04:28 | - | |
| Jungle/ | 2026-03-26 12:20 | - | |
| Jungle & Henry Counsell/ | 2026-03-26 07:07 | - | |
| Jun Miyake/ | 2026-03-26 13:29 | - | |
| Julia Michaels/ | 2026-04-19 10:57 | - | |
| Juelz Santana/ | 2026-03-26 14:42 | - | |
| Juan Gabriel y Rocío Dúrcal/ | 2025-01-27 01:41 | - | |
| Juan Gabriel/ | 2026-02-22 13:38 | - | |
| Juan Alminana Obando _ Poetry Maiden/ | 2026-03-25 12:47 | - | |
| Joywave/ | 2026-03-26 14:56 | - | |
| Joywave-Permanent Pleasure-Deluxe-2025-FLAC/ | 2026-03-25 18:07 | - | |
| Joy Orbison/ | 2026-03-26 13:36 | - | |
| Joy Division/ | 2026-04-19 10:52 | - | |
| Joseph Carl Breil/ | 2026-03-25 12:43 | - | |
| Jose Nieto/ | 2026-03-25 12:42 | - | |
| Joni van der Leeuw/ | 2026-03-25 12:41 | - | |
| Joni Mitchell/ | 2025-11-08 16:50 | - | |
| Jonas Brothers/ | 2026-04-19 10:50 | - | |
| Jon Opstad/ | 2026-03-25 12:41 | - | |
| Johnny Venus & 6LACK/ | 2026-03-25 12:41 | - | |
| Johnny Cash/ | 2026-04-19 10:48 | - | |
| John Williams; London Symphony Orchestra/ | 2026-03-25 12:39 | - | |
| John Williams/ | 2026-04-19 10:48 | - | |
| John Summit feat. CLOVES/ | 2026-03-25 12:39 | - | |
| John Summit & Hayla/ | 2026-03-25 12:38 | - | |
| John Scott/ | 2026-03-25 12:38 | - | |
| John Powell/ | 2026-03-26 08:22 | - | |
| John Ozbay/ | 2026-03-25 12:37 | - | |
| John Michael Montgomery/ | 2026-03-26 06:55 | - | |
| John Mellencamp featuring Carlene Carter/ | 2026-04-19 10:43 | - | |
| John Mayall/ | 2026-02-01 23:54 | - | |
| John Lee Hooker/ | 2026-04-19 10:40 | - | |
| John C. Maxwell/ | 2024-12-07 17:06 | - | |
| John Barry/ | 2026-04-19 10:38 | - | |
| Johann Sebastian Bach; Glenn Gould/ | 2026-03-26 15:15 | - | |
| Johann Sebastian Bach; Christiane Jaccottet/ | 2026-03-26 13:01 | - | |
| Johann Sebastian Bach/ | 2026-03-26 13:28 | - | |
| Johann Sebastian Bach, Georg Philipp Telemann; Freiburg Baroque Orchestra, Vox Luminis, Lionel Meunier/ | 2026-03-26 15:45 | - | |
| Joey Alexander/ | 2026-03-26 12:52 | - | |
| Joey Alexander-A Joey Alexander Christmas-EP-24BIT-96KHZ-WEB-FLAC-2018-OBZEN/ | 2026-03-25 12:30 | - | |
| Joey Alexander-A Joey Alexander Christmas-EP-24BIT-96KHZ-WEB-FLAC-2018-OBZEN - Copy/ | 2026-03-26 13:16 | - | |
| Joel Forssell/ | 2026-03-25 12:29 | - | |
| Joel Corry/ | 2026-03-26 06:34 | - | |
| Joe Jonas & DNCE/ | 2026-03-26 05:12 | - | |
| Joby Talbot/ | 2026-03-26 05:28 | - | |
| Jk/ | 2026-04-19 10:34 | - | |
| Jimmy Somerville/ | 2025-10-30 19:05 | - | |
| Jimmy Cliff/ | 2026-04-23 15:30 | - | |
| Jimmy Cliff & Roots Radics/ | 2024-12-18 05:08 | - | |
| Jimi Hendrix-The Ultimate Experience-1993-IRC/ | 2026-03-25 23:43 | - | |
| Jewel/ | 2026-04-23 00:26 | - | |
| Jessie Reyez/ | 2026-04-19 10:27 | - | |
| Jesse McCartney/ | 2026-03-26 11:55 | - | |
| Jesper Kyd/ | 2026-03-26 10:53 | - | |
| Jerry Goldsmith/ | 2026-03-26 12:00 | - | |
| Jeremy Inkel/ | 2024-12-07 17:22 | - | |
| Jennifer Lopez/ | 2026-04-19 10:26 | - | |
| Jem/ | 2026-04-19 10:25 | - | |
| Jefferson Airplane/ | 2026-04-19 10:24 | - | |
| Jeezy/ | 2026-03-26 04:12 | - | |
| Jean Michel Jarre/ | 2026-04-19 10:18 | - | |
| Jean-Michel Jarre/ | 2026-04-19 10:18 | - | |
| Jean‐Michel Jarre/ | 2026-04-19 10:24 | - | |
| Jazzy & KILIMANJARO/ | 2026-03-26 12:11 | - | |
| Jaymz Nylon/ | 2026-03-25 11:56 | - | |
| Jay Wadley/ | 2026-03-25 11:56 | - | |
| Jax Jones, Joel Corry & Jason Derulo/ | 2026-04-19 10:15 | - | |
| Jax Jones & Zoe Wees/ | 2026-04-19 10:14 | - | |
| Jawsh 685 x Jason Derulo/ | 2026-03-26 08:11 | - | |
| Jason Derulo/ | 2026-04-19 10:14 | - | |
| Jasmine.4.T-You Are The Morning-YBT Deluxe-WEB-2025-QUAVER-FTP/ | 2026-03-26 02:46 | - | |
| Japanese Breakfast/ | 2026-04-19 10:13 | - | |
| Jana Kramer/ | 2026-04-19 10:13 | - | |
| Jamiroquai/ | 2025-07-24 16:57 | - | |
| James Blake/ | 2026-04-19 10:11 | - | |
| James Arthur/ | 2026-04-19 10:11 | - | |
| Jaden Bojsen & David Guetta/ | 2026-03-25 11:48 | - | |
| Jade LeMac & Luca Schreiner/ | 2026-03-25 05:14 | - | |
| Jack Marshall, Bob Mosher/ | 2026-03-25 02:06 | - | |
| Jack Johnson/ | 2026-04-19 10:08 | - | |
| JX/ | 2026-03-26 11:03 | - | |
| JISOO/ | 2026-03-26 15:16 | - | |
| JENNIE/ | 2026-04-19 10:25 | - | |
| JB Dunckel & Jonathan Fitoussi/ | 2026-03-25 12:01 | - | |
| JAY-Z/ | 2026-04-19 10:17 | - | |
| JAY‐Z/ | 2026-04-19 10:17 | - | |
| JADE feat. Channel Tres/ | 2026-03-26 04:09 | - | |
| JADE/ | 2026-03-25 11:47 | - | |
| J. P. Bimeni & Moby/ | 2026-03-25 11:42 | - | |
| J.K_/ | 2026-04-19 10:07 | - | |
| J-Kwon/ | 2026-03-26 04:12 | - | |
| J‐Kwon/ | 2026-03-26 03:48 | - | |
| Isabel LaRosa/ | 2026-03-25 11:40 | - | |
| Iridium/ | 2026-03-25 11:40 | - | |
| Intermission feat. Lori Glori/ | 2026-03-25 11:37 | - | |
| Insane Clown Posse/ | 2026-02-11 09:18 | - | |
| Inhaler/ | 2026-04-19 10:01 | - | |
| Infectious Grooves/ | 2026-03-26 11:00 | - | |
| Infectious Grooves-Funk It Up and Punk It Up Live In France 95-WEB-2010-QUAVER-FTP/ | 2026-03-25 09:49 | - | |
| Infected Mushroom/ | 2026-04-19 10:00 | - | |
| In This Moment/ | 2026-04-19 10:00 | - | |
| Iggy Pop/ | 2026-03-25 11:28 | - | |
| Icona Pop/ | 2026-04-19 09:57 | - | |
| Ian Munsick/ | 2026-03-25 11:22 | - | |
| IVE/ | 2026-03-26 04:43 | - | |
| Husker Du/ | 2026-03-26 06:06 | - | |
| Howlin' Wolf/ | 2026-04-19 09:53 | - | |
| Howlin' Wolf, Muddy Waters & Bo Diddley/ | 2026-04-19 09:54 | - | |
| Howlin’ Wolf/ | 2026-04-19 09:53 | - | |
| Howlin’ Wolf, Muddy Waters & Bo Diddley/ | 2026-03-25 11:16 | - | |
| Highway 101/ | 2026-04-19 09:52 | - | |
| Herbie Mann/ | 2026-03-26 10:59 | - | |
| Herbert Harris, Scott Kuney & Frederic Hand/ | 2026-03-25 13:47 | - | |
| Henry Mancini/ | 2026-04-19 09:51 | - | |
| Henri PFR feat. Sadie Rose Van/ | 2026-03-25 11:08 | - | |
| Heidi Montag/ | 2026-03-25 11:29 | - | |
| Hedara; Dipsy/ | 2026-03-25 11:07 | - | |
| Heavy D and The Boyz-Nuttin But Love-Promo-CDS-FLAC-1994-THEVOiD INT-FTP/ | 2026-03-25 17:13 | - | |
| Heather Nova-Redbird-2005-FNT/ | 2026-03-25 19:15 | - | |
| Heart/ | 2026-04-19 09:48 | - | |
| Harry Gregson‐Williams/ | 2026-03-26 06:08 | - | |
| Hans Zimmer/ | 2026-04-19 09:46 | - | |
| Hannah Laing/ | 2026-03-25 11:00 | - | |
| Halsey/ | 2026-04-19 09:44 | - | |
| Hali Palombo/ | 2026-03-25 10:59 | - | |
| Haddaway/ | 2026-04-19 09:43 | - | |
| HUGEL, J Balvin, Ellie Goulding, Topic, Arash & Daecolm/ | 2026-03-25 11:18 | - | |
| HBz x KREMIK/ | 2026-03-25 11:05 | - | |
| HBz, KREMIK, JONAS MOLL, Cenkgo/ | 2026-03-25 11:04 | - | |
| HAIM/ | 2026-04-19 09:43 | - | |
| H-Town/ | 2026-03-26 06:42 | - | |
| H‐Town/ | 2026-03-26 08:51 | - | |
| Hüsker Dü/ | 2026-03-26 11:01 | - | |
| Gwen McCrae/ | 2026-03-26 11:11 | - | |
| Gunther feat. Samantha Fox/ | 2026-03-26 06:04 | - | |
| Guns N' Roses/ | 2026-04-19 09:40 | - | |
| Guns N’ Roses/ | 2026-04-19 09:41 | - | |
| Guided by Voices/ | 2026-03-26 08:23 | - | |
| Gucci Mane/ | 2026-03-26 15:45 | - | |
| Gucci Mane & Waka Flocka Flame/ | 2026-03-26 06:03 | - | |
| Gucci Mane & B.G_/ | 2026-03-26 07:08 | - | |
| Gryffin, Kaskade & Nu-La/ | 2026-03-26 07:22 | - | |
| Gryffin & Band of Horses/ | 2026-03-26 13:30 | - | |
| Grover Washington, Jr_/ | 2024-12-07 17:08 | - | |
| Grover Washington, Jr/ | 2026-04-22 12:34 | - | |
| Groove Coverage/ | 2026-04-19 09:34 | - | |
| Greta Van Fleet/ | 2026-04-19 09:32 | - | |
| Grace Jones/ | 2026-04-19 09:29 | - | |
| Gouryella/ | 2026-03-26 10:40 | - | |
| Gotye, FISHER & Chris Lake/ | 2026-04-19 09:28 | - | |
| Gorillaz/ | 2026-04-19 09:28 | - | |
| Gorgon City/ | 2026-04-19 09:27 | - | |
| Gordon Lightfoot/ | 2026-04-19 09:27 | - | |
| Gordo/ | 2026-03-25 10:24 | - | |
| Gordo & Maluma/ | 2026-03-25 17:47 | - | |
| Goo Goo Dolls/ | 2026-04-19 09:24 | - | |
| God Is An Astronaut-Far From Refuge-Remastered-16BIT-WEB-FLAC-2011-VEXED/ | 2026-03-25 09:15 | - | |
| Glen Campbell/ | 2025-01-26 19:00 | - | |
| Gladys Knight and the Pips/ | 2024-12-07 17:21 | - | |
| Gladys Knight & the Pips/ | 2026-01-26 20:05 | - | |
| Gerry Rafferty/ | 2026-03-26 05:15 | - | |
| Georges Delerue/ | 2026-03-26 14:20 | - | |
| George Szell/ | 2026-03-26 16:06 | - | |
| George Orwell/ | 2026-03-25 10:10 | - | |
| George Michael/ | 2026-04-19 09:16 | - | |
| George McCrae/ | 2026-03-26 13:04 | - | |
| George Jones and Tammy Wynette/ | 2025-01-26 23:19 | - | |
| George Jones/ | 2025-05-12 00:50 | - | |
| George Jones & Tammy Wynette/ | 2025-01-26 23:07 | - | |
| George Carlin/ | 2026-03-26 15:24 | - | |
| George Acosta/ | 2026-03-26 11:39 | - | |
| Gentle Giant-Playing The Fool-The Complete Live Experience-Remastered-24BIT-96KHZ-WEB-FLAC-2025-TiMES/ | 2026-03-25 18:27 | - | |
| Gary Clark Jr_/ | 2026-04-19 09:10 | - | |
| Gary Clark Jr/ | 2026-04-19 09:10 | - | |
| Galt MacDermot/ | 2026-03-26 04:18 | - | |
| Gala/ | 2026-03-26 15:32 | - | |
| Gabi Sklar & Chuckie feat. Irie/ | 2026-03-25 15:44 | - | |
| GZA_Genius/ | 2026-04-19 09:42 | - | |
| GIMS/ | 2026-04-19 09:18 | - | |
| G-Eazy/ | 2026-04-19 09:11 | - | |
| G‐Eazy/ | 2026-04-19 09:11 | - | |
| Günther & The Sunshine Girls feat. Samantha Fox/ | 2026-03-25 10:53 | - | |
| Future/ | 2026-03-26 14:53 | - | |
| Future & Metro Boomin/ | 2026-03-26 08:17 | - | |
| Frost/ | 2026-03-26 10:27 | - | |
| Fridayy/ | 2026-03-25 09:48 | - | |
| Freiburger Barockorchester/ | 2026-03-26 09:54 | - | |
| Freiburger Barockorchester, Vox Luminis & Lionel Meunier/ | 2026-03-25 09:47 | - | |
| Freeway/ | 2026-03-26 14:04 | - | |
| Frederic Talgorn/ | 2026-03-25 09:44 | - | |
| Franz Ferdinand/ | 2026-04-19 09:02 | - | |
| Frankie Ballard/ | 2026-03-26 06:48 | - | |
| Frank Chacksfield & His Orchestra/ | 2026-03-26 08:13 | - | |
| Foghat/ | 2026-02-23 15:33 | - | |
| Five Special/ | 2026-03-25 09:27 | - | |
| Five Horse Johnson/ | 2026-03-26 11:01 | - | |
| Five/ | 2026-03-26 12:23 | - | |
| Fernando Terremoto/ | 2026-03-25 09:19 | - | |
| Felix Jaehn & Whitney Houston/ | 2026-04-19 08:52 | - | |
| Fcukers/ | 2026-03-26 13:19 | - | |
| Father John Misty/ | 2026-01-17 06:03 | - | |
| Fatboy Slim/ | 2026-04-19 08:47 | - | |
| Fall Out Boy-From Under The Cork Tree-20th Anniversary Deluxe Edition-WEB-2025-MARR/ | 2026-03-25 09:13 | - | |
| Falco/ | 2026-04-22 02:54 | - | |
| Fabolous/ | 2026-03-26 06:38 | - | |
| Fabolous & Jadakiss/ | 2026-03-26 14:43 | - | |
| Fabien Waltmann/ | 2026-03-25 09:06 | - | |
| Exoplanet/ | 2026-03-26 12:14 | - | |
| Everything but the Girl/ | 2026-04-19 08:37 | - | |
| Evan LE NY/ | 2026-03-25 09:00 | - | |
| Etnica/ | 2026-03-26 10:51 | - | |
| Etienne de Crecy/ | 2026-03-26 12:10 | - | |
| Escuela de Odio/ | 2026-03-26 10:53 | - | |
| Erik Satie; Yutaka Sado, Orchestre des concerts Lamoureux/ | 2025-01-27 01:42 | - | |
| Erik Satie; Bojan Gorišek/ | 2025-01-27 01:42 | - | |
| Erik Satie; Bojan Gorišek, Jane Manning/ | 2025-01-27 01:42 | - | |
| Erik Satie/ | 2025-11-07 20:50 | - | |
| Eric Clapton/ | 2025-11-08 18:59 | - | |
| Eric Bibb/ | 2026-03-26 04:27 | - | |
| Era/ | 2026-02-16 20:51 | - | |
| Entheogenic/ | 2024-12-07 09:34 | - | |
| Ennio Morricone/ | 2026-04-19 08:25 | - | |
| Empire of the Sun & southstar/ | 2026-04-19 08:25 | - | |
| Emmylou Harris/ | 2026-04-19 08:20 | - | |
| Eminem/ | 2026-04-19 08:17 | - | |
| Eminem-Stans-The Official Soundtrack-WEB-2025-TosK-FTP/ | 2026-03-25 22:30 | - | |
| Eminem-Stans-The Official Soundtrack-OST-16BIT-WEB-FLAC-2025-LSM-FTP/ | 2026-03-25 22:30 | - | |
| Ely Oaks/ | 2026-03-26 05:35 | - | |
| Elvis Presley with the Royal Philharmonic Orchestra/ | 2024-12-18 05:07 | - | |
| Elvis Presley/ | 2026-04-25 19:40 | - | |
| Elvis Costello/ | 2026-04-19 08:13 | - | |
| Elvis Costello - King of America & Other Realms (1986, 2024 Super Deluxe, 6CDs) - 2025 - FLAC 16BITS 44.1KHZ-EICHBAUM/ | 2026-03-25 08:35 | - | |
| Elvis Costello & The Imposters/ | 2026-03-26 05:57 | - | |
| Elvis Costello & The Attractions/ | 2026-03-26 12:22 | - | |
| Elvis Costello & Allen Toussaint/ | 2026-04-19 08:14 | - | |
| Elton John/ | 2025-11-07 20:12 | - | |
| Ella Marie & Lemaitre/ | 2026-03-25 08:28 | - | |
| Ella Henderson, Switch Disco & Alok/ | 2026-04-19 08:11 | - | |
| Ella Fitzgerald/ | 2026-04-19 08:10 | - | |
| Ella Fitzgerald & Oscar Peterson/ | 2026-04-19 08:11 | - | |
| Ella Fitzgerald & Joe Pass/ | 2026-04-19 08:11 | - | |
| Ella Fitzgerald & Frank De Vol and His Orchestra/ | 2026-04-19 08:11 | - | |
| Electronic/ | 2026-03-25 17:37 | - | |
| Edie Brickell & New Bohemians/ | 2026-04-19 08:08 | - | |
| Eddie Money/ | 2026-01-31 17:27 | - | |
| Ed Sheeran/ | 2026-03-25 08:13 | - | |
| Ed Sheeran & Yelawolf/ | 2024-12-11 04:05 | - | |
| Echoes In the Night (Gai Barone Demode Remix)/ | 2026-03-25 23:06 | - | |
| Eats Everything/ | 2026-03-25 17:55 | - | |
| Eatmewhileimhot!/ | 2026-03-25 08:11 | - | |
| Earl Klugh and Bob James/ | 2026-03-25 08:11 | - | |
| ELXR/ | 2026-03-25 08:35 | - | |
| Dwight Yoakam/ | 2026-01-06 01:01 | - | |
| Dusky/ | 2026-03-25 18:42 | - | |
| Duke Ellington/ | 2026-03-25 14:36 | - | |
| Duke Ellington & Coleman Hawkins/ | 2026-03-25 21:36 | - | |
| Duck Sauce/ | 2026-03-25 16:48 | - | |
| Dua Lipa/ | 2026-04-19 07:53 | - | |
| Drake/ | 2026-04-19 07:52 | - | |
| Dr.Dre-The Next Episode-Promo CDM-2000-GCP-FTP/ | 2026-03-25 16:57 | - | |
| Dr.Dre-The Next Episode-Promo-CDM-FLAC-2000-THEVOiD-FTP/ | 2026-03-25 16:58 | - | |
| Dr. Alban/ | 2026-04-19 07:51 | - | |
| Dove Cameron/ | 2026-03-25 15:10 | - | |
| Don Toliver/ | 2026-02-04 14:08 | - | |
| Don Omar, Lucenzo & Tiesto/ | 2026-04-19 07:50 | - | |
| Dom Dolla feat. Daya/ | 2026-03-25 07:59 | - | |
| Dolly Parton/ | 2025-05-31 04:27 | - | |
| Dmitriy Redko/ | 2026-03-25 07:52 | - | |
| Djo/ | 2026-03-25 07:52 | - | |
| Divine Inspiration/ | 2026-03-25 17:01 | - | |
| Disturbed/ | 2026-04-19 07:37 | - | |
| Disco Kings/ | 2026-03-25 07:19 | - | |
| Disclosure/ | 2026-04-19 07:36 | - | |
| Disclosure & Rivo/ | 2026-04-19 07:36 | - | |
| Dirtyphonics x RIOT/ | 2026-03-25 13:26 | - | |
| Dirtyphonics/ | 2026-03-25 18:45 | - | |
| Dirtyphonics & Sullivan King/ | 2026-03-25 18:08 | - | |
| Dirtyphonics × RIOT/ | 2026-03-25 07:15 | - | |
| Dire Straits/ | 2026-04-19 07:33 | - | |
| Dipsy, Hedara/ | 2026-03-25 07:06 | - | |
| Diplo presents Thomas Wesley/ | 2026-03-25 07:05 | - | |
| Diplo/ | 2026-03-25 18:58 | - | |
| Dimitri Vegas & Like Mike, Tiesto & Dido/ | 2026-04-19 07:30 | - | |
| Diffrent/ | 2026-03-25 06:59 | - | |
| Diego Buongiorno/ | 2026-03-25 06:58 | - | |
| Diana Krall/ | 2026-04-19 07:29 | - | |
| Diana Gordon/ | 2026-03-25 19:01 | - | |
| Dewey Lambdin read by John Lee/ | 2026-03-25 06:57 | - | |
| Devin Dawson/ | 2026-03-25 15:12 | - | |
| Denon Reed & Cru2/ | 2026-03-25 11:20 | - | |
| Dennis Ferrer/ | 2026-03-25 18:45 | - | |
| Delerium/ | 2026-04-19 07:26 | - | |
| Deftones/ | 2026-04-19 07:25 | - | |
| Deep Dive/ | 2026-03-25 06:50 | - | |
| DeeJay Froggy & DJ Raffy/ | 2026-03-25 06:49 | - | |
| Decadance/ | 2026-03-25 06:48 | - | |
| Dean Martin/ | 2026-03-25 13:46 | - | |
| Dean Lewis with Sofia Camara/ | 2026-04-19 07:22 | - | |
| Dean Lewis/ | 2026-04-19 07:22 | - | |
| Deadsy/ | 2026-03-25 20:15 | - | |
| Dead Can Dance/ | 2026-04-19 07:20 | - | |
| David Shire/ | 2026-03-25 17:02 | - | |
| David Newman/ | 2026-03-25 20:07 | - | |
| David Hasselhoff/ | 2026-04-19 07:19 | - | |
| David Guetta feat. Tara McDonald/ | 2026-03-25 06:34 | - | |
| David Guetta feat. Sam Martin/ | 2026-04-19 07:16 | - | |
| David Guetta feat. Max Elto/ | 2026-04-19 07:15 | - | |
| David Guetta feat. Kid Cudi/ | 2026-04-19 07:15 | - | |
| David Guetta feat. Justin Bieber/ | 2026-04-19 07:14 | - | |
| David Guetta feat. Flo Rida and Nicki Minaj/ | 2026-04-19 07:14 | - | |
| David Guetta feat. Estelle/ | 2026-04-19 07:14 | - | |
| David Guetta feat. Cozi/ | 2026-04-19 07:13 | - | |
| David Guetta feat. Akon/ | 2026-04-19 07:12 | - | |
| David Guetta X MORTEN/ | 2026-04-19 07:18 | - | |
| David Guetta Feat. Nicki Minaj & Afrojack/ | 2026-04-19 07:15 | - | |
| David Guetta Feat. Chris Brown & Lil Wayne/ | 2026-04-19 07:13 | - | |
| David Guetta/ | 2026-04-19 07:01 | - | |
| David Guetta, Mason & Princess Superstar/ | 2026-03-25 06:34 | - | |
| David Guetta, MORTEN & Prophecy/ | 2026-04-19 07:18 | - | |
| David Guetta, Girl on Couch & Billen Ted/ | 2026-04-19 07:17 | - | |
| David Guetta, Cedric Gervais & Chris Willis/ | 2026-04-19 07:12 | - | |
| David Guetta, Alphaville & Ava Max/ | 2026-04-19 07:11 | - | |
| David Guetta & Sia/ | 2026-04-19 07:10 | - | |
| David Guetta & Showtek feat. MAGIC! & Sonny Wilson/ | 2026-04-19 07:10 | - | |
| David Guetta & Nicky Romero/ | 2026-04-19 07:09 | - | |
| David Guetta & MORTEN/ | 2026-04-19 07:09 | - | |
| David Guetta & GLOWINTHEDARK/ | 2026-04-19 07:09 | - | |
| David Guetta & Chris Willis vs. Tocadisco/ | 2026-04-19 07:08 | - | |
| David Guetta & Cedric Gervais/ | 2026-04-19 07:07 | - | |
| David Guetta & Alesso feat. Madison Love/ | 2026-04-19 07:07 | - | |
| David Guetta & Afrojack feat. Niles Mason/ | 2026-04-19 07:07 | - | |
| David Guetta & Afrojack feat. Charli xcx and French Montana/ | 2026-04-19 07:06 | - | |
| David Guetta & AFROJACK/ | 2026-04-19 07:06 | - | |
| David Gray/ | 2026-04-19 06:57 | - | |
| David Bowie/ | 2025-11-01 07:38 | - | |
| Dave Matthews Band/ | 2026-04-19 06:55 | - | |
| Dave Matthews Band-Where Are You Going-The Singles-WEB-2025-MARR/ | 2026-03-25 05:53 | - | |
| Dasha/ | 2026-04-19 06:54 | - | |
| Darude/ | 2026-04-19 06:54 | - | |
| Darkside/ | 2026-04-19 06:53 | - | |
| Dark By Design/ | 2026-03-25 05:47 | - | |
| Danzig/ | 2026-04-19 06:52 | - | |
| Daniele Busciala x Earl W Green/ | 2026-03-25 22:50 | - | |
| Daniel Seavey/ | 2026-03-25 16:22 | - | |
| Dan Romer & Saul Simon-MacWilliams/ | 2026-03-25 05:44 | - | |
| Dan Gibson/ | 2026-03-25 15:13 | - | |
| Dan Gibson's Solitudes/ | 2026-03-25 13:52 | - | |
| Dan Curtin/ | 2026-03-25 05:42 | - | |
| Dan + Shay/ | 2026-04-19 06:49 | - | |
| Damiano David/ | 2026-03-25 13:27 | - | |
| DMX/ | 2026-04-19 07:48 | - | |
| DJ tiesto/ | 2026-04-19 07:47 | - | |
| DJ Vivona/ | 2026-03-25 20:48 | - | |
| DJ Snake feat. Lauv/ | 2026-04-19 07:46 | - | |
| DJ Snake/ | 2026-04-19 07:46 | - | |
| DJ Snake & Lil Jon ft. Juicy J, 2 Chainz & French Montana/ | 2026-04-19 07:46 | - | |
| DJ Sammy/ | 2026-04-19 07:45 | - | |
| DJ Marky/ | 2026-03-25 07:37 | - | |
| DJ Marky & XRS/ | 2026-03-25 07:39 | - | |
| DJ Hell, Truncate, DJ T-1000 & Mark Broom/ | 2026-03-25 16:33 | - | |
| DJ Gas and DJ Lulu/ | 2026-03-25 07:35 | - | |
| DJ Drama, Hardo & Deezlee/ | 2026-03-25 07:33 | - | |
| DJ BoBo/ | 2026-04-19 07:39 | - | |
| DJ Aligator feat. Christina Undhjem/ | 2026-03-25 14:46 | - | |
| DJ Aligator Project feat. Christina Undhjem/ | 2026-03-25 07:26 | - | |
| D.O.D feat. NORTH/ | 2026-03-25 05:38 | - | |
| D.J. BoBo/ | 2026-04-19 06:47 | - | |
| D.I.T.C_/ | 2026-03-25 19:48 | - | |
| Cypress Hill/ | 2026-04-19 06:40 | - | |
| Cynthia Erivo/ | 2026-03-25 18:26 | - | |
| Cybotron/ | 2026-03-25 15:14 | - | |
| Curtis Mayfield/ | 2026-04-19 06:39 | - | |
| Crystal Waters, ManyFew & OFFAIAH/ | 2026-03-26 02:46 | - | |
| Crystal Rain/ | 2026-03-25 05:24 | - | |
| Crowder/ | 2026-03-25 17:32 | - | |
| Crowded House/ | 2026-04-19 06:37 | - | |
| Craig Safan/ | 2026-03-25 05:19 | - | |
| Craig David/ | 2026-03-10 11:28 | - | |
| Cosmic Gate/ | 2026-04-19 06:35 | - | |
| Cosmic Baby/ | 2026-03-25 05:15 | - | |
| Consequence/ | 2026-03-26 15:09 | - | |
| Common/ | 2026-04-19 06:33 | - | |
| Common & Pete Rock/ | 2026-03-25 05:12 | - | |
| Coldplay/ | 2026-04-19 06:33 | - | |
| Coldplay & Zerb/ | 2026-04-19 06:33 | - | |
| Cocoon/ | 2026-03-25 20:08 | - | |
| Coco Jones/ | 2026-04-19 06:32 | - | |
| Clueless/ | 2026-03-25 05:07 | - | |
| Clive Cussler/ | 2024-12-07 17:28 | - | |
| Clean Bandit, Anne-Marie & Ruger/ | 2026-04-19 06:31 | - | |
| Clawfinger/ | 2026-04-19 06:30 | - | |
| Circus of Power-Circus of Power-Remastered-2009-GRW/ | 2026-03-25 05:05 | - | |
| Circa Waves/ | 2026-04-19 06:30 | - | |
| Ciara/ | 2026-04-19 06:29 | - | |
| Chumbawamba/ | 2026-03-10 10:23 | - | |
| Chrystal/ | 2026-03-25 05:02 | - | |
| Chromeo-Business Casual-(Deluxe Edition Bonus Tracks)-2010-C4/ | 2026-03-25 04:14 | - | |
| Christian McBride/ | 2026-01-02 04:10 | - | |
| Christian McBride & Edgar Meyer/ | 2025-01-27 01:41 | - | |
| Chriss Ronson/ | 2026-03-25 05:01 | - | |
| Chris Tilton/ | 2026-03-25 05:00 | - | |
| Chris Brown/ | 2026-04-19 06:24 | - | |
| Choses Sauvages/ | 2026-03-25 04:57 | - | |
| Chocolate Dice/ | 2026-03-25 04:57 | - | |
| Chicane vs. Natasha Bedingfield/ | 2026-04-19 06:21 | - | |
| Chicane vs. Natasha Bedingfield - Bruised Water (2008 Promo)(CDM)[FLAC][MP3]/ | 2026-03-25 04:56 | - | |
| Chicane vs. Natasha Bedingfield - Bruised Water (2008 Promo)(CDM)[FLAC][MP3] - Copy/ | 2026-03-25 04:57 | - | |
| Chicane feat. Natasha Bedingfield/ | 2026-03-25 04:55 | - | |
| Chicane/ | 2026-04-19 06:19 | - | |
| Chicago-The Chicago Story-Complete Greatest Hits-Remastered-2CD-2002-ERP INT-FTP/ | 2026-03-25 04:53 | - | |
| Cherrelle/ | 2026-03-25 16:24 | - | |
| Cher-Its A Mans World-1996-EOS/ | 2026-03-25 11:41 | - | |
| Cheat Codes & Ownboss/ | 2026-04-19 06:18 | - | |
| Cheap Trick-In Color-(Reissue)-1998-DNR/ | 2026-03-25 11:32 | - | |
| Chase & Status & Stormzy/ | 2026-04-19 06:17 | - | |
| Charli xcx/ | 2026-04-19 06:13 | - | |
| Charlie Chaplin/ | 2026-03-25 14:35 | - | |
| Chappell Roan/ | 2026-03-25 16:10 | - | |
| Celine Dion/ | 2026-04-19 06:10 | - | |
| Cat Power/ | 2026-04-19 06:10 | - | |
| Carly Pearce/ | 2026-04-19 06:09 | - | |
| Carlos Santana/ | 2026-04-19 06:08 | - | |
| Carlos Santana & Mahavishnu John McLaughlin/ | 2026-03-25 04:31 | - | |
| Carlos Santana & John McLaughlin/ | 2026-04-19 06:08 | - | |
| Carl Thomas/ | 2026-03-25 19:09 | - | |
| Captain & Tennille/ | 2026-04-19 06:06 | - | |
| Canvas/ | 2026-03-25 04:27 | - | |
| Candi_Staton-Hallelujah_Anyway_(Remixes)-(DFTD363D3)-WEB-2013-BPM/ | 2026-03-25 04:27 | - | |
| Candi_Staton-Hallelujah_Anyway_(Remixes)-(DFTD363D3)-WEB-2013-BPM - Copy/ | 2026-03-25 15:33 | - | |
| Candi Staton/ | 2026-03-25 18:42 | - | |
| Camron-S.D.E.Japanese Edition-2000-GCP-FTP/ | 2026-03-25 20:14 | - | |
| Camron-S.D.E.JP Retail-CD-FLAC-2000-THEVOiD-FTP/ | 2026-03-25 20:15 | - | |
| Camp Lo/ | 2026-03-25 14:26 | - | |
| Cameron Whitcomb/ | 2026-03-25 21:40 | - | |
| Cam'ron featuring Ludacris, Trina, UGK and Juelz Santana/ | 2026-03-25 19:34 | - | |
| Calvin Harris with Ellie Goulding/ | 2026-04-19 06:03 | - | |
| Calvin Harris/ | 2026-04-19 06:02 | - | |
| Calvin Harris & Rihanna/ | 2026-03-25 23:16 | - | |
| Calvin Harris & Rag'n'Bone Man/ | 2026-04-19 06:02 | - | |
| Cake-Showroom Of Compassion-2011-FNT/ | 2026-03-25 20:52 | - | |
| CYRIL/ | 2026-03-25 05:36 | - | |
| CYRIL & maryjo/ | 2026-03-25 05:36 | - | |
| Céline Dion/ | 2026-04-19 06:10 | - | |
| Butthole Surfers/ | 2026-04-19 05:59 | - | |
| Bush/ | 2026-04-19 05:59 | - | |
| Bus Stop/ | 2026-03-25 17:06 | - | |
| Bun B/ | 2026-03-25 16:42 | - | |
| Bullet/ | 2026-04-19 05:58 | - | |
| Bud Powell/ | 2024-12-07 11:18 | - | |
| Buck Owens/ | 2026-03-25 05:20 | - | |
| Bryan's Magic Tears/ | 2026-03-25 04:04 | - | |
| Bruce Broughton/ | 2026-03-25 13:25 | - | |
| Brooklyn Bounce; Paffendorf/ | 2026-03-25 04:02 | - | |
| Brooklyn Bounce/ | 2026-03-25 19:29 | - | |
| Brookes Brothers/ | 2026-03-25 18:40 | - | |
| Bronski Beat feat. Neil Tennant/ | 2026-03-26 02:34 | - | |
| Britney Spears-The Singles Collection-2009-VAG/ | 2026-03-25 20:59 | - | |
| Brenda Lee with orchestra and chorus directed by Owen Bradley/ | 2026-03-25 18:06 | - | |
| Brenda Lee/ | 2026-03-25 16:03 | - | |
| Brandy/ | 2026-04-19 05:51 | - | |
| Brandi Cyrus/ | 2026-03-25 03:56 | - | |
| Bowling For Soup-Fishin For Woos-Deluxe Edition-16BIT-WEB-FLAC-2025-VEXED/ | 2026-03-25 03:55 | - | |
| Bootsy Collins/ | 2026-03-25 20:09 | - | |
| Bonnie Banane/ | 2026-03-25 03:51 | - | |
| Bon Jovi-New Jersey-LP-FLAC-1988-ERP-FTP/ | 2026-03-25 16:56 | - | |
| Bon Iver/ | 2026-04-19 05:45 | - | |
| Bobby Darin/ | 2026-03-25 21:36 | - | |
| Bobby And Steve x Byron Stingily/ | 2026-03-25 23:11 | - | |
| Bob Marley/ | 2026-04-19 05:42 | - | |
| Bob Marley & The Wailers/ | 2026-04-19 05:42 | - | |
| Bob James and Earl Klugh/ | 2026-03-25 03:43 | - | |
| Bob James Trio/ | 2026-03-25 03:43 | - | |
| Bob James/ | 2026-03-25 18:39 | - | |
| Bob Dylan and The Band/ | 2026-03-25 03:40 | - | |
| Bob Dylan _ The Band/ | 2024-12-18 05:07 | - | |
| Bob Dylan/ | 2026-03-25 03:37 | - | |
| Bob Dylan & Tom Petty/ | 2024-12-11 04:04 | - | |
| Bob Dylan & The Band/ | 2024-12-07 17:09 | - | |
| Bob Dylan & Grateful Dead/ | 2026-04-19 05:38 | - | |
| Blue Oyster Cult/ | 2026-04-19 05:30 | - | |
| Blue Öyster Cult/ | 2026-04-19 05:31 | - | |
| Blossoms/ | 2026-04-19 05:30 | - | |
| Blondie/ | 2026-04-19 05:29 | - | |
| Blondie-Plastic Letters-6307617-LP-FLAC-1978-BITOCUL/ | 2026-03-25 03:30 | - | |
| Blondie-Plastic Letters-6307617-LP-FLAC-1978-BITOCUL - Copy/ | 2026-04-19 05:30 | - | |
| Blank & Jones - Relax Edition Five (flac)/ | 2026-03-25 19:17 | - | |
| Blake Shelton/ | 2026-04-19 05:26 | - | |
| Blaine L. Reininger/ | 2026-03-26 15:24 | - | |
| Black Moon/ | 2026-03-25 18:19 | - | |
| Black Loops, Marlena Dae/ | 2026-03-25 03:22 | - | |
| Black Country, New Road/ | 2026-04-19 05:20 | - | |
| Bjork/ | 2026-04-19 05:12 | - | |
| Björk/ | 2026-04-19 05:20 | - | |
| Bing Crosby/ | 2026-03-25 17:16 | - | |
| Bill Laswell/ | 2026-03-25 15:14 | - | |
| Bill Evans/ | 2026-04-19 05:09 | - | |
| Bill Evans & Jim Hall/ | 2026-04-19 05:10 | - | |
| Biig Piig/ | 2026-03-25 15:57 | - | |
| Biche/ | 2026-03-25 02:59 | - | |
| Betty Wright/ | 2026-04-19 05:08 | - | |
| Bert Kaempfert/ | 2026-03-25 13:27 | - | |
| Benson Boone/ | 2026-03-25 20:09 | - | |
| Benny Goodman and His Orchestra/ | 2026-03-26 15:14 | - | |
| Benjamin Blumchen/ | 2024-12-07 17:22 | - | |
| Benjamin Blümchen/ | 2025-01-26 18:08 | - | |
| Ben Liebrand/ | 2026-04-19 05:06 | - | |
| Ben Hemsley feat. Chenai Zinyuku/ | 2026-03-25 02:54 | - | |
| Ben Harper/ | 2026-04-19 05:05 | - | |
| Ben Harper-The Will To Live-CD-FLAC-1997-Mrflac-T1T/ | 2026-03-25 02:53 | - | |
| Ben Harper-The Will To Live-CD-FLAC-1997-Mrflac-T1T - Copy/ | 2026-04-19 05:05 | - | |
| Belasco/ | 2026-03-25 02:52 | - | |
| Beethoven; Pollini/ | 2025-01-26 18:08 | - | |
| Beethoven; Maurizio Pollini/ | 2024-12-18 05:07 | - | |
| Beethoven; Artur Schnabel/ | 2024-12-11 04:04 | - | |
| Beenie Man/ | 2026-03-26 15:07 | - | |
| Becky Hill x MK/ | 2026-03-25 02:50 | - | |
| Becky Hill/ | 2026-04-19 05:01 | - | |
| Beanie Sigel-The Truth-Promo-VLS-FLAC-2000-THEVOiD-FTP/ | 2026-03-25 23:39 | - | |
| Bassnectar/ | 2026-03-25 13:12 | - | |
| Bass 305/ | 2026-03-25 02:37 | - | |
| Basil Poledouris/ | 2026-03-25 21:40 | - | |
| Basic Element/ | 2026-03-25 16:26 | - | |
| Basement Jaxx/ | 2026-04-19 04:53 | - | |
| Barry White/ | 2026-04-19 04:52 | - | |
| Barenaked Ladies/ | 2026-04-19 04:51 | - | |
| Barbra Streisand/ | 2026-04-19 04:46 | - | |
| Bananarama/ | 2026-04-19 04:45 | - | |
| Bailey Zimmerman/ | 2026-03-25 13:10 | - | |
| Bagarre/ | 2026-03-25 17:04 | - | |
| Badger & Natasha Bedingfield/ | 2026-03-25 02:26 | - | |
| Bad Boys Blue/ | 2026-03-25 17:09 | - | |
| Bach; Christiane Jaccottet/ | 2026-03-25 02:24 | - | |
| Babyface/ | 2026-04-19 04:39 | - | |
| Babyface-The Day-Reissue Expanded Edition-WEB-2001-UVU-FTP/ | 2026-03-25 06:38 | - | |
| Baby Bash featuring Marty Obey & MC Magic/ | 2026-03-25 02:23 | - | |
| Baby Bash & Lucky Luciano/ | 2026-04-19 04:36 | - | |
| BUNT_/ | 2026-03-25 05:23 | - | |
| BT/ | 2026-04-19 05:56 | - | |
| BLEU/ | 2026-03-25 19:45 | - | |
| BL3SS & CamrinWatsin feat. bbyclose/ | 2026-03-25 05:20 | - | |
| BINI/ | 2026-03-25 03:04 | - | |
| B.B. King/ | 2026-03-25 02:22 | - | |
| Axel Rudi Pell/ | 2026-04-19 04:34 | - | |
| Avraan/ | 2026-03-25 14:01 | - | |
| Avicii vs Nicky Romero/ | 2026-04-19 04:33 | - | |
| Avery Anna/ | 2026-03-25 18:45 | - | |
| Avenged Sevenfold/ | 2026-04-19 04:29 | - | |
| Austin Wintory/ | 2026-03-26 15:23 | - | |
| AudioGaming/ | 2026-03-25 02:16 | - | |
| Audio & Black Sun Empire/ | 2026-03-25 13:05 | - | |
| AstroPilot/ | 2026-04-19 04:16 | - | |
| Ashnikko-Demidevil-Deluxe Edition-CD-FLAC-2024-PERFECT-FTP/ | 2026-03-25 06:52 | - | |
| Artista desconocido/ | 2026-03-25 23:26 | - | |
| Art Longo/ | 2026-03-25 02:02 | - | |
| Art Blakey and The Jazz Messengers/ | 2026-03-25 13:28 | - | |
| Art Blakey/ | 2026-03-25 18:37 | - | |
| Art Blakey & The Jazz Messengers/ | 2026-03-25 19:58 | - | |
| Armin van Buuren presents Alibi/ | 2024-12-07 17:15 | - | |
| Armin van Buuren feat. Jan Vayne/ | 2026-04-19 04:12 | - | |
| Armin van Buuren/ | 2026-04-19 04:11 | - | |
| Armin van Buuren, VIZE & Leony/ | 2026-03-25 01:59 | - | |
| Armand van Helden presents Old School Junkies/ | 2026-03-25 01:57 | - | |
| Armand van Helden/ | 2026-04-19 04:08 | - | |
| Armando Trovajoli/ | 2026-03-25 01:58 | - | |
| Ariana Grande/ | 2026-03-25 01:53 | - | |
| Archie Pelago/ | 2026-03-25 01:52 | - | |
| Aquascape/ | 2026-03-25 01:52 | - | |
| Apollo Brown/ | 2026-04-19 04:04 | - | |
| Apollo Brown & Ras Kass/ | 2026-04-19 04:05 | - | |
| Apocalyptica/ | 2026-03-25 03:03 | - | |
| Anyma & Ellie Goulding/ | 2026-03-25 01:48 | - | |
| Antonio Vivaldi/ | 2026-04-19 04:02 | - | |
| Antonio Vivaldi, Henry Purcell; Saint Paul Chamber Orchestra, Pinchas Zukerman, English Chamber Orchestra, Raymond Leppard/ | 2026-04-19 04:03 | - | |
| Anastacia/ | 2025-03-24 08:51 | - | |
| Ana Maria Martinez/ | 2026-03-25 16:18 | - | |
| Amil/ | 2026-02-11 07:43 | - | |
| Amerie/ | 2026-01-03 10:15 | - | |
| Amelie Lens/ | 2025-01-26 23:28 | - | |
| Amari, Tobi Ibitoye/ | 2026-03-25 22:51 | - | |
| Amanda Lear/ | 2026-03-25 15:22 | - | |
| Amanch/ | 2026-03-25 02:48 | - | |
| Aly & Fila/ | 2026-03-25 01:46 | - | |
| Altan/ | 2026-03-25 01:41 | - | |
| All Time Low/ | 2026-03-25 01:38 | - | |
| All That Remains/ | 2026-03-25 01:33 | - | |
| Alkalino/ | 2026-03-25 02:46 | - | |
| Alizée/ | 2025-08-04 08:20 | - | |
| Alison Krauss And Union Station-Arcadia-24BIT-44KHZ-WEB-FLAC-2025-OBZEN/ | 2025-06-27 09:21 | - | |
| Alison Krauss/ | 2026-03-25 01:24 | - | |
| Alison Krauss & Union Station/ | 2026-03-25 01:25 | - | |
| Alice Babs/ | 2025-01-26 18:02 | - | |
| Alibi/ | 2025-11-14 21:33 | - | |
| Algorithmic Funk/ | 2024-07-17 01:46 | - | |
| Alexis Korner's Blues Incorporated/ | 2024-10-06 22:26 | - | |
| Alexis Korner’s Blues Incorporated/ | 2025-01-26 22:52 | - | |
| Alexia/ | 2025-09-09 23:48 | - | |
| Alexey Romeo feat. Joel Edwards/ | 2024-07-17 01:43 | - | |
| Alexandre Desplat/ | 2026-03-16 19:49 | - | |
| Alexandra Stan/ | 2026-01-05 17:36 | - | |
| Alexandra Stan & Inna feat. Daddy Yankee/ | 2024-12-11 04:05 | - | |
| Alexander O'Neal/ | 2024-12-07 09:00 | - | |
| Alexander O’Neal/ | 2026-02-28 16:48 | - | |
| Alexander Koning/ | 2024-07-17 01:31 | - | |
| Alexander Courage/ | 2026-03-25 22:33 | - | |
| Alexander Alar, Bakhova/ | 2024-07-17 01:31 | - | |
| Alex Winston/ | 2024-12-08 06:41 | - | |
| Alex Wicked/ | 2024-12-07 09:59 | - | |
| Alex Turner/ | 2026-01-15 23:02 | - | |
| Alex Ranerro/ | 2024-07-17 01:31 | - | |
| Alex Progress/ | 2024-07-17 01:31 | - | |
| Alex Party/ | 2025-05-30 15:33 | - | |
| Alex Megane/ | 2024-12-07 12:12 | - | |
| Alex M.O.R.P.H. feat. Sylvia Tosun/ | 2025-02-05 05:47 | - | |
| Alex Hook, Rene/ | 2024-07-17 01:30 | - | |
| Alex Guesta/ | 2024-07-17 01:30 | - | |
| Alex Galiver/ | 2024-07-17 01:30 | - | |
| Alex Dimou/ | 2024-12-07 08:08 | - | |
| Alex Clare/ | 2024-07-17 01:30 | - | |
| Alex/ | 2025-10-15 18:23 | - | |
| Alesso vs. OneRepublic/ | 2024-12-07 08:38 | - | |
| Alessia Cara/ | 2026-03-25 01:21 | - | |
| Aleqs Notal/ | 2024-07-17 01:30 | - | |
| Aleon Craft/ | 2024-07-17 01:30 | - | |
| Alejandro Marcovich/ | 2024-07-17 01:30 | - | |
| Ale B/ | 2024-07-17 01:30 | - | |
| Alberta Hunter/ | 2024-12-07 08:22 | - | |
| Albert King with Stevie Ray Vaughan/ | 2024-07-17 01:29 | - | |
| Albert King/ | 2026-03-25 01:18 | - | |
| Albert Collins/ | 2026-02-04 06:37 | - | |
| Albert Castiglia/ | 2024-12-07 15:09 | - | |
| Alastair Greene/ | 2024-12-07 10:20 | - | |
| Alaska!/ | 2024-07-17 01:25 | - | |
| Alan Walker X Hans Zimmer/ | 2025-02-03 12:28 | - | |
| Alan Walker/ | 2026-04-25 19:45 | - | |
| Alan Walker, Sabrina Carpenter & Farruko/ | 2025-02-03 12:19 | - | |
| Alan Walker, Noah Cyrus & Digital Farm Animals feat. Juliander/ | 2024-12-11 04:05 | - | |
| Alan Walker, Noah Cyrus & Digital Farm Animals/ | 2024-12-20 23:29 | - | |
| Alan Walker, A$AP Rocky/ | 2024-12-11 04:04 | - | |
| Alan Walker & Sophia Somajo/ | 2024-12-11 04:04 | - | |
| Alan Walker & Hans Zimmer/ | 2024-12-11 04:04 | - | |
| Alan Walker & Ava Max/ | 2025-02-03 12:29 | - | |
| Alan Walker & Alex Skrindo/ | 2024-12-11 04:04 | - | |
| Alan Parsons Project/ | 2024-07-17 01:21 | - | |
| Alan Jenkins & Thurston Lava Tube/ | 2024-07-17 01:21 | - | |
| Alan Jackson/ | 2025-07-09 17:00 | - | |
| Alabama Shakes/ | 2026-04-20 07:33 | - | |
| Al Jarreau/ | 2026-03-25 01:09 | - | |
| Al Bizzare/ | 2025-07-08 14:53 | - | |
| Akon ft. Lil Wayne/ | 2024-07-17 01:18 | - | |
| Akira/ | 2024-07-17 01:18 | - | |
| Akinyele/ | 2024-12-07 15:38 | - | |
| Akcent/ | 2026-04-20 07:08 | - | |
| Air Supply/ | 2026-01-15 23:02 | - | |
| Aimee Mann/ | 2026-03-25 01:09 | - | |
| Ahzee/ | 2024-07-17 01:08 | - | |
| Agua Clara/ | 2024-07-17 01:08 | - | |
| Ages and Ages/ | 2024-12-07 13:27 | - | |
| Agent!/ | 2024-07-17 01:08 | - | |
| After the Smoke/ | 2024-07-17 01:07 | - | |
| Afterdark _ 16bit/ | 2024-07-17 01:07 | - | |
| After The Snow/ | 2024-07-17 01:07 | - | |
| Afroman/ | 2026-03-25 01:08 | - | |
| Afrojack/ | 2025-07-14 01:16 | - | |
| Afrojack, Dimitri Vegas, Like Mike & NERVO/ | 2024-12-11 04:04 | - | |
| Afrojack, Dimitri Vegas & Like Mike & NERVO/ | 2025-02-03 09:13 | - | |
| Afrika Bambaataa & Soulsonic Force/ | 2026-03-25 01:05 | - | |
| Afflicted/ | 2026-03-25 02:47 | - | |
| Aerobass/ | 2026-03-25 02:49 | - | |
| Adele/ | 2026-03-25 01:05 | - | |
| Add-2/ | 2026-03-25 20:27 | - | |
| Adam and the Ants/ | 2025-10-30 04:42 | - | |
| Adam Helder/ | 2024-07-17 00:58 | - | |
| Adam Ant/ | 2025-10-30 04:45 | - | |
| Acumen & Monastetiq/ | 2024-07-17 00:55 | - | |
| Actual Proof/ | 2024-07-17 00:55 | - | |
| Activate/ | 2024-07-17 00:55 | - | |
| Action Bronson/ | 2025-10-30 04:38 | - | |
| Action Bronson & Statik Selektah/ | 2024-12-11 04:05 | - | |
| Acting Damage/ | 2024-07-17 00:52 | - | |
| Aceyalone/ | 2026-03-25 01:00 | - | |
| Ace Young/ | 2024-07-17 00:52 | - | |
| Ace Hood/ | 2025-10-30 04:24 | - | |
| Ace Frehley/ | 2025-10-30 04:21 | - | |
| Ace Cannon/ | 2024-12-07 12:19 | - | |
| Absolute a Cappella/ | 2024-07-17 00:37 | - | |
| Abrial/ | 2024-07-17 00:37 | - | |
| Above & Beyond presents Tranquility Base/ | 2024-07-17 00:37 | - | |
| Above & Beyond presents OceanLab/ | 2024-10-06 22:26 | - | |
| Above & Beyond feat. Richard Bedford/ | 2024-07-17 00:36 | - | |
| Above & Beyond and Spencer Brown feat. RBBTS/ | 2025-02-03 13:08 | - | |
| Abel/ | 2024-07-17 00:36 | - | |
| Abbacadabra/ | 2024-12-07 13:27 | - | |
| Aaron the Baron/ | 2024-07-17 00:36 | - | |
| Aaron Waters/ | 2024-07-17 00:36 | - | |
| Aaron Smith feat. Luvli/ | 2024-07-17 00:36 | - | |
| Aaron Neville/ | 2026-03-25 01:00 | - | |
| Aaron Keylock/ | 2025-07-03 19:33 | - | |
| Aaron Hall/ | 2025-05-30 14:32 | - | |
| Aaran D/ | 2024-12-07 08:08 | - | |
| Aaliyah/ | 2026-02-11 07:36 | - | |
| AVAION & Sofiya Nzau/ | 2026-03-25 02:19 | - | |
| AURORA/ | 2026-04-19 04:25 | - | |
| AUDREY NUNA/ | 2026-03-26 06:16 | - | |
| A Thousand Horses/ | 2026-04-19 18:24 | - | |
| ATEEZ X Don Diablo/ | 2026-03-25 17:20 | - | |
| ATEEZ/ | 2026-03-25 12:58 | - | |
| ATC/ | 2026-03-25 16:43 | - | |
| ATB presents Jades/ | 2026-04-19 04:21 | - | |
| ATB/ | 2026-04-19 04:16 | - | |
| AR_CO x Punctual x NewEra/ | 2026-03-25 01:52 | - | |
| A Plus D/ | 2026-03-25 18:27 | - | |
| A Little Sound & Sugababes feat. KILIMANJARO/ | 2026-03-25 21:00 | - | |
| ALON/ | 2026-03-25 19:37 | - | |
| AJ Tracey/ | 2024-12-07 08:52 | - | |
| AJR/ | 2026-04-20 07:04 | - | |
| A Hard Mountain/ | 2026-03-25 11:03 | - | |
| A Great Big World/ | 2026-04-19 09:31 | - | |
| AG/ | 2026-04-20 06:43 | - | |
| A Flock of Seagulls with The Prague Philharmonic Orchestra/ | 2026-03-25 09:38 | - | |
| A Flock of Seagulls with Prague Philharmonic Orchestra/ | 2026-04-19 09:00 | - | |
| A Flock of Seagulls/ | 2026-04-19 08:57 | - | |
| A Fine Frenzy/ | 2026-04-19 08:53 | - | |
| AFX _ Autechre/ | 2024-07-17 01:07 | - | |
| AC_DC/ | 2025-01-26 17:28 | - | |
| ACDC/ | 2025-01-26 17:28 | - | |
| AC+DC/ | 2026-04-20 04:25 | - | |
| A Boogie Wit da Hoodie/ | 2026-03-25 17:18 | - | |
| ABC/ | 2026-02-13 14:25 | - | |
| A.Kay B.J._A Kay B Jay/ | 2026-03-25 07:20 | - | |
| A$AP Rocky/ | 2026-01-22 03:00 | - | |
| 909 Resistance/ | 2026-03-25 02:47 | - | |
| 112/ | 2026-03-07 20:58 | - | |
| 101 Strings/ | 2026-03-25 00:59 | - | |
| 50 Cent-The Massacre-REAL PROPER-CD-FLAC-2005-THEVOiD-FTP/ | 2026-03-25 15:21 | - | |
| 42 Dugg/ | 2026-04-23 09:31 | - | |
| 42 Dugg & Roddy Ricch/ | 2024-07-17 00:08 | - | |
| 42 Dugg & EST Gee/ | 2024-12-11 04:04 | - | |
| 24kGoldn/ | 2025-05-27 20:55 | - | |
| 21 Savage/ | 2025-10-29 20:29 | - | |
| 20 Fingers/ | 2025-03-25 10:48 | - | |
| 12 Stones/ | 2026-02-14 06:05 | - | |
| 10,000 Maniacs/ | 2026-02-20 02:04 | - | |
| 4mat/ | 2025-07-15 03:08 | - | |
| 4hero/ | 2024-12-07 09:41 | - | |
| 4 Strings/ | 2025-06-27 15:50 | - | |
| 4 Strings & Tina Cousins/ | 2024-12-18 05:07 | - | |
| 4 Non Blondes/ | 2025-10-29 21:36 | - | |
| 3rd Party/ | 2024-07-17 00:04 | - | |
| 3naMassa/ | 2024-07-17 00:04 | - | |
| 3 Doors Down/ | 2026-03-17 21:26 | - | |
| 3D3KS & GgDeX/ | 2024-07-17 00:04 | - | |
| 2 Unlimited/ | 2025-03-24 07:56 | - | |
| 2 Chainz/ | 2025-10-29 20:17 | - | |
| 2 Brothers on the 4th Floor/ | 2025-10-29 20:12 | - | |
| 2 Brothers On The 4th Floor & Da Smooth Baron MC/ | 2025-11-11 23:38 | - | |
| -NOFX-Wolves In Wolves Clothing-CD-FLAC-2006-JLM/ | 2026-03-26 02:42 | - | |
| $uicideboy$/ | 2024-10-06 22:31 | - | |
| “Weird Al” Yankovic/ | 2026-04-19 19:46 | - | |
|
|---|