![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 04 Vampires.flac | 2026-09-12 12:01 | 34M | |
| 10 La Femme Parallel.flac | 2026-09-18 06:02 | 30M | |
| 15 Sweet Tides.flac | 2026-09-19 12:23 | 30M | |
| 02 Mandala.flac | 2026-09-12 03:43 | 28M | |
| 01 Sound the Alarm.flac | 2026-09-11 23:32 | 25M | |
| 08 33_.flac | 2026-09-15 07:59 | 25M | |
| 06 El Pueblo Unido.flac | 2026-09-12 23:46 | 25M | |
| 05 Hare Krsna.flac | 2026-09-12 17:51 | 24M | |
| 14 Blasting Through the City.flac | 2026-09-19 08:04 | 24M | |
| 03 Radio Retaliation.flac | 2026-09-12 08:35 | 23M | |
| 13 The Shining Path.flac | 2026-09-19 02:17 | 22M | |
| 12 The Numbers Game.flac | 2026-09-18 20:47 | 22M | |
| 07 (The Forgotten People).flac | 2026-09-15 02:09 | 22M | |
| 09 Beautiful Drug.flac | 2026-09-15 15:16 | 21M | |
| 11 Retaliation Suite.flac | 2026-09-18 15:53 | 19M | |
| album.nfo | 2026-10-05 06:01 | 3.8K | |