![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Safe European Home.flac | 2026-09-11 21:53 | 89M | |
| 02 English Civil War.flac | 2026-09-12 02:33 | 59M | |
| 03 Tommy Gun.flac | 2026-09-12 06:31 | 76M | |
| 04 Julie's Been Working for the Drug Squad.flac | 2026-09-12 11:10 | 70M | |
| 05 Last Gang in Town.flac | 2026-09-12 15:31 | 123M | |
| 06 Guns on the Roof.flac | 2026-09-12 21:14 | 74M | |
| 07 Drug-Stabbing Time.flac | 2026-09-14 03:15 | 86M | |
| 08 Stay Free.flac | 2026-09-15 05:07 | 85M | |
| 09 Cheapskates.flac | 2026-09-15 11:58 | 79M | |
| 10 All the Young Punks (New Boots and Contracts).flac | 2026-09-18 03:56 | 114M | |
| album.nfo | 2026-09-28 11:05 | 3.2K | |
| folder.jpg | 2026-09-28 11:05 | 1.3M | |