![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](backdrop1.jpg){kind=small}
![[IMG]](banner.jpg){kind=small}
![[IMG]](clearlogo.png){kind=small}
![[IMG]](cover.jpg){kind=small}
![[IMG]](fanart.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
![[IMG]](logo.png){kind=logo}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 The Chemical Brothers feat. The Flaming Lips - The Golden Path (edit).mp3 | 2026-09-12 01:35 | 6.2M | |
| 05 The Chemical Brothers feat. The Flaming Lips - The Golden Path (Ewan's Rave Hell dub).mp3 | 2026-09-12 19:16 | 10M | |
| album.nfo | 2026-10-13 16:03 | 1.7K | |
| backdrop1.jpg | 2026-07-15 05:27 | 98K | |
| banner.jpg | 2026-07-15 05:27 | 40K | |
| clearlogo.png | 2026-07-15 05:27 | 112K | |
| cover.jpg | 2026-07-15 05:27 | 12K | |
| fanart.jpg | 2026-07-15 05:27 | 379K | |
| folder.jpg | 2026-07-15 05:27 | 61K | |
| logo.png | 2026-07-15 05:27 | 82K | |