![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](cover.png){kind=small}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Warm Leatherette.flac | 2026-10-02 12:30 | 41M | |
| 02 Private Life.flac | 2026-10-03 18:02 | 41M | |
| 03 A Rolling Stone.flac | 2026-10-05 17:50 | 27M | |
| 04 Love Is the Drug.flac | 2026-09-12 11:17 | 58M | |
| 05 The Hunter Gets Captured by the Game.flac | 2026-09-12 16:03 | 45M | |
| 06 Bullshit.flac | 2026-09-12 22:21 | 37M | |
| 07 Breakdown.flac | 2026-09-14 20:43 | 32M | |
| 08 Pars.flac | 2026-09-15 06:18 | 32M | |
| album.nfo | 2026-10-04 11:06 | 2.1K | |
| cover.png | 2026-07-15 07:32 | 4.1M | |
| folder.jpg | 2026-07-15 07:32 | 108K | |