![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| folder.jpg | 2026-10-05 10:35 | 91K | |
| album.nfo | 2026-10-05 10:35 | 3.5K | |
| 10 Unbroken.flac | 2025-09-25 16:55 | 41M | |
| 09 Brothers in Arms.flac | 2026-09-15 13:20 | 33M | |
| 08 Blood in the Water.flac | 2026-09-15 05:48 | 40M | |
| 07 Lower the Flag.flac | 2026-09-14 23:15 | 30M | |
| 06 Let It Rain.flac | 2026-09-12 22:27 | 35M | |
| 05 Story of Love.flac | 2026-09-12 16:17 | 38M | |
| 04 Beautiful Drug.flac | 2026-09-12 12:25 | 29M | |
| 03 American Reckoning.flac | 2026-09-12 07:59 | 27M | |
| 02 Do What You Can.flac | 2026-09-12 03:16 | 32M | |
| 01 Limitless.flac | 2026-09-11 23:19 | 27M | |