![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-10-01 04:32 | 2.8K | |
| folder.jpg | 2026-10-01 04:31 | 2.0M | |
| 13 Lullaby for Helene [Quartet].flac | 2026-09-19 03:41 | 13M | |
| 07 Lullaby for Helene.flac | 2026-09-15 02:57 | 14M | |
| 05 The Dolphin - Before.flac | 2026-09-12 18:46 | 16M | |
| 04 Soiree.flac | 2026-09-12 13:50 | 17M | |
| 12 Soiree (alternate take).flac | 2026-09-18 21:24 | 17M | |
| 09 Children's Play Song.flac | 2026-09-15 15:20 | 20M | |
| 06 The Dolphin - After.flac | 2026-09-13 00:28 | 20M | |
| 01 What Are You Doing the Rest of Your Life_.flac | 2026-09-12 00:17 | 20M | |
| 11 Why Did I Choose You_ [Quartet].flac | 2026-09-18 15:32 | 21M | |
| 10 What Are You Doing the Rest of Your Life_ [Quartet].flac | 2026-09-18 07:35 | 23M | |
| 03 Why Did I Choose You_.flac | 2026-09-12 08:13 | 26M | |
| 08 Like Someone in Love.flac | 2026-09-15 06:35 | 30M | |
| 02 I'm All Smiles.flac | 2026-09-12 03:21 | 31M | |