![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 What Are You Doing the Rest of Your Life_.flac | 2025-09-25 15:42 | 20M | |
| 02 I'm All Smiles.flac | 2025-09-25 15:42 | 31M | |
| 03 Why Did I Choose You_.flac | 2025-09-25 15:42 | 25M | |
| 04 Soiree.flac | 2025-09-25 15:42 | 16M | |
| 05 The Dolphin - Before.flac | 2025-09-25 15:42 | 16M | |
| 06 The Dolphin - After.flac | 2025-09-25 15:42 | 20M | |
| 07 Lullaby for Helene.flac | 2025-09-25 15:42 | 14M | |
| 08 Like Someone in Love.flac | 2025-09-25 15:42 | 30M | |
| 09 Children's Play Song.flac | 2025-09-25 15:42 | 20M | |
| 10 What Are You Doing the Rest of Your Life_ [Quartet].flac | 2025-09-25 15:42 | 23M | |
| 11 Why Did I Choose You_ [Quartet].flac | 2025-09-25 15:42 | 21M | |
| 12 Soiree (alternate take).flac | 2025-09-25 15:42 | 17M | |
| 13 Lullaby for Helene [Quartet].flac | 2025-09-25 15:42 | 12M | |
| album.nfo | 2026-01-26 12:24 | 2.6K | |