![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](backdrop.jpg){kind=small}
![[IMG]](banner.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
![[IMG]](logo.png){kind=logo}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| The Nexus/ | 2026-07-14 22:08 | - | |
| The Nexus (deluxe edition)/ | 2026-07-14 22:08 | - | |
| The Catalyst/ | 2026-07-14 22:08 | - | |
| Maximalism/ | 2026-07-14 22:08 | - | |
| Maximalism (2016)/ | 2026-07-14 22:08 | - | |
| Massive Addictive/ | 2026-07-14 22:08 | - | |
| Helix/ | 2026-07-14 22:08 | - | |
| Helix (2018)/ | 2026-07-14 22:08 | - | |
| Digital World/ | 2026-07-14 22:08 | - | |
| Digital World (2015)/ | 2026-07-14 22:08 | - | |
| Amaranthe/ | 2026-07-14 22:08 | - | |
| Amaranthe (2011)/ | 2026-07-14 22:08 | - | |
| backdrop.jpg | 2026-07-15 06:51 | 328K | |
| banner.jpg | 2026-07-15 06:51 | 153K | |
| folder.jpg | 2026-07-15 06:51 | 71K | |
| logo.png | 2026-07-15 06:51 | 43K | |
| artist.nfo | 2026-07-15 06:51 | 3.3K | |
| album.nfo | 2026-07-15 06:51 | 484 | |