![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](cdart.png){kind=small}
![[IMG]](cover.jpg){kind=small}
![[IMG]](discart.png){kind=small}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 This Calling.mp3 | 2026-07-15 06:46 | 9.2M | |
| 02 Not Alone.mp3 | 2026-07-15 06:46 | 8.9M | |
| 03 It Dwells in Me.mp3 | 2026-07-15 06:46 | 8.3M | |
| 04 We Stand.mp3 | 2026-07-15 06:46 | 9.5M | |
| 05 Whispers (I Hear Your).mp3 | 2026-07-15 06:46 | 9.2M | |
| 06 The Weak Willed.mp3 | 2026-07-15 06:46 | 10M | |
| 07 Six.mp3 | 2026-07-15 06:46 | 8.6M | |
| 08 Become the Catalyst.mp3 | 2026-07-15 06:46 | 8.0M | |
| 09 The Air That I Breathe.mp3 | 2026-07-15 06:46 | 9.0M | |
| 10 Empty Inside.mp3 | 2026-07-15 06:46 | 8.6M | |
| 11 Indictment.mp3 | 2026-07-15 06:46 | 9.3M | |
| album.nfo | 2026-07-15 06:46 | 4.2K | |
| cdart.png | 2026-07-15 06:46 | 589K | |
| cover.jpg | 2026-07-15 06:46 | 515K | |
| discart.png | 2026-07-15 06:46 | 589K | |
| folder.jpg | 2026-07-15 06:46 | 146K | |