![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](cover.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-09-25 05:19 | 5.7K | |
| cover.jpg | 2026-07-15 06:27 | 307K | |
| 19 Behind Ambient (ATB's Ambient Version).flac | 2026-09-20 01:45 | 22M | |
| 23 Listen to Me.flac | 2026-09-20 08:17 | 22M | |
| 26 Malibu Road.flac | 2026-09-20 11:21 | 23M | |
| 18 Voices.flac | 2026-09-19 23:02 | 24M | |
| 20 Authentic Reaction.flac | 2026-09-20 04:20 | 25M | |
| 16 Missing.flac | 2026-09-19 17:17 | 27M | |
| 14 Communicate.flac | 2026-09-19 07:28 | 27M | |
| 08 Luminescence.flac | 2026-09-15 07:12 | 28M | |
| 12 My Saving Grace.flac | 2026-09-18 19:40 | 29M | |
| 09 Behind.flac | 2026-09-15 13:41 | 30M | |
| 15 Talismanic.flac | 2026-09-19 12:19 | 30M | |
| 04 A New Day.flac | 2026-09-12 12:03 | 33M | |
| 24 Living Life Over.flac | 2026-09-20 09:36 | 33M | |
| 25 Silent Meaning.flac | 2026-09-20 10:21 | 33M | |
| 01 L.A. Nights.flac | 2026-10-02 21:28 | 33M | |
| 17 Horizon.flac | 2026-09-19 19:49 | 35M | |
| 11 Still Here.flac | 2026-09-18 13:20 | 36M | |
| 05 My Everything.flac | 2026-09-12 16:20 | 37M | |
| 13 Terra 260273.flac | 2026-09-19 00:22 | 39M | |
| 10 Future Memories.flac | 2026-09-18 05:06 | 39M | |
| 22 Twilight.flac | 2026-09-20 06:09 | 40M | |
| 06 Summervibes with 9PM.flac | 2026-09-12 22:13 | 40M | |
| 07 Gravity.flac | 2026-09-14 14:12 | 40M | |
| 03 Swept Away.flac | 2026-10-05 09:00 | 41M | |
| 02 What About Us.flac | 2026-10-03 18:01 | 41M | |
| 21 Careless.flac | 2026-09-20 05:13 | 43M | |