![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-09-30 17:15 | 4.2K | |
| folder.jpg | 2022-06-03 18:44 | 216K | |
| 11 It's All True.flac | 2026-09-18 16:09 | 16M | |
| 06 My Drug Buddy.flac | 2026-09-13 00:35 | 19M | |
| 03 Into Your Arms.flac | 2026-09-12 09:06 | 19M | |
| 07 It's About Time.flac | 2026-09-15 02:23 | 20M | |
| 09 If I Could Talk I'd Tell You.flac | 2026-09-15 15:18 | 20M | |
| 01 Confetti.flac | 2026-09-12 00:12 | 21M | |
| 10 The Great Big No.flac | 2026-09-18 07:56 | 21M | |
| 04 It's a Shame About Ray.flac | 2026-09-12 13:18 | 22M | |
| 02 Rudderless.flac | 2026-09-12 04:11 | 24M | |
| 07 Ride With Me (acoustic).flac | 2025-10-06 08:24 | 24M | |
| 05 Mrs. Robinson.flac | 2026-09-12 17:28 | 26M | |
| 08 Big Gay Heart.flac | 2026-09-15 06:14 | 33M | |