![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[IMG]](discart.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-09-24 17:06 | 2.9K | |
| folder.jpg | 2024-10-07 00:04 | 121K | |
| discart.jpg | 2023-07-15 11:39 | 244K | |
| 12 The Boomtown Rats - Lookin' After No. 1.flac | 2025-10-06 08:59 | 25M | |
| 08 Banana Republic.flac | 2026-09-15 07:51 | 25M | |
| 01 She's So Modern.flac | 2026-09-11 23:28 | 25M | |
| 11 Like Clockwork.flac | 2026-09-18 14:11 | 29M | |
| 10 I Don't Like Mondays.flac | 2026-09-18 06:02 | 30M | |
| 14 Never in a Million Years.flac | 2026-09-19 07:09 | 31M | |
| 15 Diamond Smiles.flac | 2026-09-19 12:16 | 31M | |
| 18 The Elephants Graveyard.flac | 2026-09-19 22:44 | 31M | |
| 15 Mary of the 4th Form (single version).flac | 2026-09-19 12:15 | 31M | |
| 06 Someone's Looking at You.flac | 2026-09-12 22:28 | 35M | |
| 03 Rat Trap.flac | 2026-09-12 07:12 | 36M | |
| 07 Joey's on the Street Again.flac | 2025-10-06 09:00 | 43M | |