![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 05 Otto Rahn.mp3 | 2026-09-12 18:47 | 16M | |
| 10 Apocalypse Fatigue.mp3 | 2026-09-18 09:23 | 13M | |
| 08 Soul Invictus.mp3 | 2026-09-15 09:47 | 12M | |
| 09 21st Century Lullaby.mp3 | 2026-09-15 16:10 | 11M | |
| 06 The Corporate Homoerotic Cyclists.mp3 | 2026-09-13 01:33 | 9.5M | |
| 01 The Plug-In Drug.mp3 | 2026-09-12 01:01 | 9.2M | |
| 02 Everything Is Under Control.mp3 | 2026-09-12 05:24 | 8.8M | |
| 03 Adolph's Library.mp3 | 2026-09-12 10:14 | 7.9M | |
| 04 Bleak Is My Favourite Chic.mp3 | 2026-09-12 14:47 | 7.7M | |
| 07 The New Cocksucker Blues.mp3 | 2026-09-15 04:00 | 7.5M | |
| folder.jpg | 2025-10-25 05:46 | 98K | |
| album.nfo | 2026-05-31 00:14 | 2.3K | |