![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-03-13 20:51 | 2.1K | |
| folder.jpg | 2024-02-02 18:51 | 367K | |
| 07 The Way She Smiles.flac | 2026-09-15 02:32 | 18M | |
| 05 Betcha by Golly Wow.flac | 2026-09-12 17:27 | 26M | |
| 08 Jungle Strut.flac | 2026-09-15 07:33 | 26M | |
| 02 Tambura.flac | 2026-09-12 03:31 | 29M | |
| 03 Love Song.flac | 2026-09-12 07:34 | 31M | |
| 10 Sun Goddess.flac | 2026-09-18 05:26 | 35M | |
| 06 To Know Her.flac | 2026-09-12 22:23 | 36M | |
| 04 Living for the City.flac | 2026-09-12 11:49 | 37M | |
| 09 Sharing Her Journey.flac | 2026-09-15 12:35 | 42M | |
| 01 Intimacy.flac | 2026-09-11 22:13 | 48M | |