![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 03 Goodbye Kiss.flac | 2026-10-05 02:19 | 49M | |
| 02 Days Are Forgotten.flac | 2026-10-03 16:38 | 62M | |
| album.nfo | 2026-09-30 14:45 | 6.2K | |
| 01 Let's Roll Just Like We Used To.flac | 2026-09-24 08:01 | 56M | |
| 11 Neon Noon.flac | 2026-09-18 12:38 | 54M | |
| 10 Switchblade Smiles.flac | 2026-09-18 04:36 | 48M | |
| 09 Man of Simple Pleasures.flac | 2026-09-15 12:28 | 45M | |
| 08 Re-Wired.flac | 2026-09-15 05:20 | 56M | |
| 07 I Hear Voices.flac | 2026-09-14 11:47 | 44M | |
| 06 Acid Turkish Bath (Shelter From the Storm).flac | 2026-09-12 21:16 | 70M | |
| 05 Velociraptor!.flac | 2026-09-12 16:22 | 37M | |
| 04 La fee verte.flac | 2026-09-12 11:14 | 64M | |
| folder.jpg | 2025-02-02 03:00 | 59K | |