![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](discart.png){kind=small}
![[IMG]](cdart.png){kind=small}
![[IMG]](folder.jpg){kind=small}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 La Vie en rose.flac | 2025-10-06 19:50 | 54M | |
| 05 Love Is the Drug.flac | 2025-10-06 19:50 | 41M | |
| 09 My Jamaican Guy.flac | 2026-09-15 12:53 | 38M | |
| 04 Private Life.flac | 2025-10-06 19:50 | 31M | |
| 10 Slave to the Rhythm.flac | 2026-09-18 06:13 | 29M | |
| 05 I've Seen That Face Before (Libertango).flac | 2026-09-12 17:22 | 27M | |
| 08 Walking in the Rain.flac | 2026-09-15 07:54 | 25M | |
| 02 I Need a Man.flac | 2026-10-04 00:21 | 24M | |
| 07 Pull Up to the Bumper.flac | 2026-09-15 01:46 | 24M | |
| 03 Do or Die.flac | 2026-10-05 22:12 | 22M | |
| discart.png | 2022-11-07 16:56 | 862K | |
| cdart.png | 2022-11-08 04:13 | 862K | |
| folder.jpg | 2024-10-07 02:04 | 185K | |
| album.nfo | 2026-09-25 10:46 | 4.9K | |