![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](discart.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-09-25 10:44 | 2.8K | |
| 13 I've Seen That Face Before (Libertango).mp3 | 2026-09-19 03:54 | 11M | |
| 12 Walking in the Rain.mp3 | 2026-09-18 22:00 | 10M | |
| 11 My Jamaican Guy.mp3 | 2026-09-18 16:23 | 14M | |
| 10 La Vie en rose.mp3 | 2026-09-18 08:41 | 17M | |
| 09 Demolition Man.mp3 | 2026-09-15 16:24 | 9.6M | |
| 08 Breakdown.mp3 | 2026-09-15 09:42 | 13M | |
| 07 Nipple to the Bottle.mp3 | 2026-09-15 02:58 | 14M | |
| 06 Nightclubbing.mp3 | 2026-09-13 01:13 | 12M | |
| 05 Love Is the Drug.mp3 | 2026-09-12 18:19 | 20M | |
| 04 Pull Up to the Bumper.mp3 | 2026-09-12 14:13 | 11M | |
| 03 Warm Leatherette.mp3 | 2026-09-12 09:36 | 13M | |
| 02 Inspiration.mp3 | 2026-09-12 05:10 | 11M | |
| 01 Private Life.mp3 | 2026-09-12 00:36 | 15M | |
| discart.jpg | 2024-01-13 03:57 | 67K | |
| folder.jpg | 2024-01-13 03:57 | 271K | |