![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 The Inevitable Relapse.flac | 2026-09-11 23:27 | 25M | |
| 02 Drug Boy.flac | 2026-09-12 03:40 | 28M | |
| 03 Absentee Father.flac | 2026-09-12 07:45 | 29M | |
| 04 No Love.flac | 2026-09-12 12:19 | 30M | |
| 05 No Re-Entry.flac | 2026-09-12 16:22 | 37M | |
| 06 Down With Me.flac | 2026-09-12 23:23 | 27M | |
| 07 Catch a Falling Knife.flac | 2026-09-15 01:08 | 27M | |
| 08 The Trouble With Angels.flac | 2025-10-06 20:44 | 27M | |
| 09 Clouds.flac | 2026-09-15 14:30 | 25M | |
| 10 Fades Like a Photograph (Dead Angel).flac | 2026-09-18 06:47 | 26M | |
| 11 Leaving Without a Note.flac | 2026-09-18 14:22 | 28M | |
| 12 Drug Boy (remix).flac | 2026-09-18 19:56 | 27M | |
| album.nfo | 2026-09-25 07:13 | 4.8K | |
| folder.jpg | 2025-02-02 10:23 | 94K | |