![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 System....flac | 2026-09-11 22:32 | 37M | |
| 02 ...Meltdown.flac | 2026-09-12 02:27 | 75M | |
| 03 Sssnakepit.flac | 2026-09-12 06:34 | 73M | |
| 04 Search Party.flac | 2026-09-12 11:06 | 80M | |
| 05 Arguing With Thermometers.flac | 2026-09-12 15:43 | 72M | |
| 06 Stalemate.flac | 2026-09-12 21:09 | 86M | |
| 07 Gandhi Mate, Gandhi.flac | 2026-09-14 02:36 | 88M | |
| 08 Warm Smiles Do Not Make You Welcome Here.flac | 2026-09-15 05:03 | 95M | |
| 09 Pack of Thieves.flac | 2026-09-15 11:37 | 82M | |
| 10 Hello Tyrannosaurus, Meet Tyrannicide.flac | 2026-09-18 04:07 | 75M | |
| 11 Constellations.flac | 2026-09-18 12:17 | 92M | |
| album.nfo | 2026-09-25 05:24 | 4.5K | |
| folder.jpg | 2024-10-07 03:12 | 136K | |