![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](backdrop1.jpg){kind=small}
![[IMG]](banner.jpg){kind=small}
![[IMG]](clearlogo.png){kind=small}
![[IMG]](cover.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
![[IMG]](logo.png){kind=logo}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 The Catalyst.flac | 2026-09-11 22:08 | 51M | |
| 02 Insatiable.flac | 2026-09-12 02:46 | 44M | |
| 03 Damnation Flame.flac | 2026-09-12 06:47 | 50M | |
| 04 Liberated.flac | 2026-09-12 11:32 | 45M | |
| 05 Re-Vision.flac | 2026-09-12 16:03 | 44M | |
| 06 Interference.flac | 2026-09-12 21:36 | 46M | |
| 07 Stay a Little While.flac | 2026-09-14 10:29 | 47M | |
| 08 Ecstasy.flac | 2026-09-15 05:36 | 44M | |
| 09 Breaking the Waves.flac | 2026-09-15 12:25 | 47M | |
| 10 Outer Dimensions.flac | 2026-09-18 04:45 | 45M | |
| 11 Resistance.flac | 2026-09-18 12:59 | 43M | |
| 12 Find Life.flac | 2026-09-18 18:52 | 44M | |
| album.nfo | 2026-09-25 01:02 | 2.7K | |
| backdrop1.jpg | 2026-07-15 06:51 | 328K | |
| banner.jpg | 2026-07-15 06:51 | 153K | |
| clearlogo.png | 2026-07-15 06:51 | 104K | |
| cover.jpg | 2026-07-15 06:51 | 6.5M | |
| folder.jpg | 2026-07-15 06:51 | 71K | |
| logo.png | 2026-07-15 06:51 | 43K | |