![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](backdrop.jpg){kind=small}
![[IMG]](logo.png){kind=logo}
![[IMG]](banner.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-08-24 12:20 | 5.3K | |
| backdrop.jpg | 2026-08-24 12:20 | 49K | |
| logo.png | 2026-08-24 12:20 | 55K | |
| banner.jpg | 2026-08-24 12:20 | 61K | |
| folder.jpg | 2026-08-24 12:20 | 95K | |
| 08 Dry My Tears and Move On.flac | 2026-08-24 12:20 | 24M | |
| 05 Hard on Me.flac | 2026-08-24 12:20 | 42M | |
| 07 Uninhabited Man.flac | 2026-08-24 12:20 | 32M | |
| 11 That's All, Amen, Close the Door.flac | 2026-08-24 12:20 | 39M | |
| 04 Two-Faced Love.flac | 2026-08-24 12:20 | 29M | |
| 06 Crawl Back (Under My Stone).flac | 2026-08-24 12:20 | 26M | |
| 01 Cooksferry Queen.flac | 2026-08-24 12:20 | 29M | |
| 09 Walking the Long Miles Home.flac | 2026-08-24 12:20 | 28M | |
| 02 Sibella.flac | 2026-08-24 12:20 | 28M | |
| 12 Hope You Like the New Me.flac | 2026-08-24 12:20 | 27M | |
| 03 Bathsheba Smiles.flac | 2026-08-24 12:20 | 27M | |
| 10 Sights and Sounds of London Town.flac | 2026-08-24 12:20 | 31M | |