![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](discart.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-08-24 12:19 | 2.7K | |
| discart.jpg | 2026-08-24 12:18 | 74K | |
| folder.jpg | 2026-08-24 12:18 | 205K | |
| 04 Jet Plane in a Rocking Chair.mp3 | 2026-08-24 12:18 | 5.9M | |
| 01 She Twists the Knife Again.mp3 | 2026-08-24 12:18 | 6.6M | |
| 08 Devonside.mp3 | 2026-08-24 12:19 | 7.3M | |
| 09 Meet on the Ledge.mp3 | 2026-08-24 12:19 | 7.3M | |
| 05 A Heart Needs a Home.mp3 | 2026-08-24 12:18 | 8.1M | |
| 03 Genesis Hall.mp3 | 2026-08-24 12:19 | 8.2M | |
| 11 Bathsheba Smiles.mp3 | 2026-08-24 12:18 | 8.3M | |
| 10 Keep Your Distance.mp3 | 2026-08-24 12:18 | 8.4M | |
| 14 Why Must I Plead_.mp3 | 2026-08-24 12:19 | 9.6M | |
| 12 Crazy Man Michael.mp3 | 2026-08-24 12:19 | 10M | |
| 06 Pharaoh.mp3 | 2026-08-24 12:18 | 10M | |
| 02 The Ghost of You Walks.mp3 | 2026-08-24 12:18 | 11M | |
| 07 Gethsemane.mp3 | 2026-08-24 12:19 | 12M | |
| 13 Guns are the Tongues.mp3 | 2026-08-24 12:19 | 14M | |