![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](cover.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1-01 Vertigo.mp3 | 2026-08-08 11:24 | 5.5M | |
| 1-02 Miracle Drug.mp3 | 2026-08-08 11:24 | 5.8M | |
| 1-03 Sometimes You Can't Make It on Your Own.mp3 | 2026-08-08 11:24 | 7.1M | |
| 1-04 Love and Peace or Else.mp3 | 2026-08-08 11:24 | 7.1M | |
| 1-05 City of Blinding Lights.mp3 | 2026-08-08 11:24 | 8.6M | |
| 1-06 All Because of You.mp3 | 2026-08-08 11:24 | 6.4M | |
| 1-07 A Man and a Woman.mp3 | 2026-08-08 11:24 | 6.1M | |
| 1-08 Crumbs From Your Table.mp3 | 2026-08-08 11:24 | 8.2M | |
| 1-09 One Step Closer.mp3 | 2026-08-08 11:24 | 5.3M | |
| 1-10 Original of the Species.mp3 | 2026-08-08 11:24 | 7.3M | |
| 1-11 Yahweh.mp3 | 2026-08-08 11:24 | 6.8M | |
| album.nfo | 2026-09-24 08:32 | 5.4K | |
| cover.jpg | 2026-08-08 11:24 | 83K | |