![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](back.jpg){kind=small}
![[IMG]](front.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| - Thor (2018).txt | 2024-11-26 13:08 | 799 | |
| back.jpg | 2024-11-26 13:08 | 97K | |
| front.jpg | 2024-11-26 13:08 | 58K | |
| 1.Chasing the Storm.mp3 | 2025-02-17 01:47 | 7.4M | |
| 2.Prologue.mp3 | 2025-02-17 03:02 | 7.3M | |
| 3.Sons of Odin.mp3 | 2025-02-17 10:24 | 4.2M | |
| 4.A New King.mp3 | 2025-02-17 18:18 | 7.0M | |
| 5.Ride to Observatory.mp3 | 2025-02-18 04:41 | 5.0M | |
| 6.To Jotunheim.mp3 | 2025-02-18 12:34 | 5.4M | |
| 7.Laufey.mp3 | 2025-02-18 19:19 | 8.5M | |
| 8.Frost Giant Battle.mp3 | 2025-02-19 02:56 | 10M | |
| 9.Banishment.mp3 | 2025-02-19 12:24 | 4.4M | |
| 10.Crisis in Asgard.mp3 | 2025-02-19 19:18 | 5.4M | |
| 11.Odin Confesses.mp3 | 2025-02-20 01:18 | 6.3M | |
| 12.Hammer Found.mp3 | 2025-02-23 18:43 | 2.8M | |
| 13.Urgent Matter.mp3 | 2025-02-23 22:53 | 5.5M | |
| 14.The Compound.mp3 | 2025-02-24 01:24 | 18M | |
| 15.Loki's Lie.mp3 | 2025-02-24 06:39 | 4.4M | |
| 16.My Bastard Son.mp3 | 2025-02-24 09:50 | 6.1M | |
| 17.Science and Magic.mp3 | 2025-02-24 12:48 | 6.7M | |
| 18.The Destroyer.mp3 | 2025-02-24 14:30 | 6.8M | |
| 19.Forgive Me.mp3 | 2025-02-24 15:57 | 6.2M | |
| 20.Thor Kills the Destroyer.mp3 | 2025-02-24 17:09 | 4.4M | |
| 21.Brothers Fight.mp3 | 2025-02-24 17:36 | 16M | |
| 22.Letting Go.mp3 | 2025-02-24 18:30 | 7.6M | |
| 23.Can You See Jane.mp3 | 2025-02-24 19:06 | 5.5M | |
| 24.Earth to Asgard.mp3 | 2025-02-24 19:31 | 5.9M | |
| album.nfo | 2026-04-12 22:24 | 3.9K | |