![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | unsorted/ | 2026-08-08 10:04 | - | |
| twenty one pilots/ | 2026-08-08 08:48 | - | |
| overpass/ | 2026-08-08 08:59 | - | |
| Zucchero Sugar Fornaciari/ | 2026-08-08 09:57 | - | |
| Zucchero Fornaciari/ | 2026-08-08 09:57 | - | |
| Zucchero/ | 2026-08-08 09:57 | - | |
| Zucchero & The Randy Jackson Band/ | 2026-08-08 09:57 | - | |
| Young Jeezy/ | 2026-08-08 08:46 | - | |
| YoungBoy Never Broke Again/ | 2026-08-08 08:46 | - | |
| Yasiin Bey/ | 2026-08-08 10:00 | - | |
| Wyclef Jean/ | 2026-08-08 08:47 | - | |
| Winnie Msowoya/ | 2026-08-08 08:45 | - | |
| Willie Nelson/ | 2026-08-08 08:47 | - | |
| William Shatner/ | 2026-08-08 08:47 | - | |
| William Shatner, Ben Folds, National Symphony Orchestra & Steven Reineke/ | 2026-08-08 08:47 | - | |
| William Shatner & Jeff Cook/ | 2026-08-08 08:47 | - | |
| White Lies/ | 2026-06-19 17:22 | - | |
| Ween/ | 2026-08-08 08:47 | - | |
| Waliko Makhala/ | 2026-08-08 08:45 | - | |
| Volbeat/ | 2026-08-18 10:32 | - | |
| Various Artists/ | 2026-08-08 10:04 | - | |
| Vanessa Litta/ | 2026-08-08 08:45 | - | |
| Uriah Heep/ | 2026-08-08 08:47 | - | |
| Ummet Ozcan x Otyken/ | 2026-08-08 10:03 | - | |
| Ummet Ozcan feat. Chris Crone/ | 2026-08-08 08:47 | - | |
| Ummet Ozcan/ | 2026-08-08 10:04 | - | |
| Ummet Ozcan, Will Sparks/ | 2026-08-08 09:58 | - | |
| Ummet Ozcan & Will Sparks/ | 2026-08-08 09:58 | - | |
| Ultravox/ | 2026-07-11 23:00 | - | |
| U2/ | 2026-08-08 10:04 | - | |
| Tyla/ | 2026-08-08 08:48 | - | |
| Tucker Zimmerman/ | 2026-08-08 08:48 | - | |
| Tom Waits/ | 2026-08-08 09:58 | - | |
| Todd Rundgren/ | 2026-08-08 08:48 | - | |
| Tina Turner/ | 2026-08-08 09:58 | - | |
| Till Lindemann feat. Benjamin Bazzazian/ | 2026-08-08 10:04 | - | |
| Till Lindemann/ | 2026-08-08 10:04 | - | |
| Till Lindemann, Burak Yeter/ | 2026-08-08 09:03 | - | |
| Till Lindemann & David Garrett/ | 2026-08-08 09:03 | - | |
| Thomas Fersen/ | 2025-03-02 01:20 | - | |
| The Who/ | 2026-08-08 08:49 | - | |
| The Waterboys/ | 2026-08-08 09:58 | - | |
| The Strokes/ | 2026-08-08 08:49 | - | |
| The Pogues/ | 2026-08-05 13:17 | - | |
| The Piano guys/ | 2025-02-17 03:44 | - | |
| The Offspring/ | 2026-08-08 08:49 | - | |
| The National/ | 2026-08-15 09:20 | - | |
| The Modern Jazz Quartet/ | 2026-08-08 09:59 | - | |
| The Long Road/ | 2026-08-08 08:44 | - | |
| The Limiñanas/ | 2026-08-08 08:46 | - | |
| The Lemonheads/ | 2026-08-08 09:05 | - | |
| The Kasambwe Brothers/ | 2026-08-08 08:45 | - | |
| The Hollywood String Quartet/ | 2026-04-02 20:17 | - | |
| The Goo Goo Dolls/ | 2026-08-08 10:02 | - | |
| The Cranberries/ | 2026-08-08 08:49 | - | |
| The Count Basie Orchestra Directed bY Frank Foster/ | 2026-08-08 08:49 | - | |
| The Count Basie Orchestra/ | 2026-08-08 09:16 | - | |
| The Cold Stares/ | 2026-06-02 12:03 | - | |
| The Chemical Brothers/ | 2026-08-08 08:50 | - | |
| The Black Eyed Peas/ | 2026-08-08 08:51 | - | |
| The Beatles/ | 2026-08-08 08:52 | - | |
| The Beaches/ | 2026-08-08 08:46 | - | |
| Tesla/ | 2026-08-08 08:53 | - | |
| Taylor Swift/ | 2026-08-08 08:53 | - | |
| Talking Heads/ | 2026-08-08 08:53 | - | |
| T.I_/ | 2026-08-08 08:55 | - | |
| System of a Down/ | 2026-08-08 08:56 | - | |
| Sum 41/ | 2026-08-08 08:56 | - | |
| Stray Kids/ | 2026-08-07 05:13 | - | |
| Steve Aoki/ | 2026-08-08 08:56 | - | |
| Stan Getz, Gerry Mulligan, Harry Edison, Louis Bellson and The Oscar Peterson Trio/ | 2026-08-08 08:57 | - | |
| Soundtracks/ | 2025-02-11 10:44 | - | |
| Soul Asylum/ | 2026-08-08 08:57 | - | |
| Solarstone/ | 2026-08-08 09:59 | - | |
| Soen/ | 2026-08-03 10:33 | - | |
| Snowden Ibbu/ | 2026-08-08 08:45 | - | |
| Smashing Pumpkins/ | 2026-08-08 08:57 | - | |
| Slipknot/ | 2026-08-08 08:57 | - | |
| Shostakovich-The.Solo.Piano.Works-Caroline.Weichert.2020.[FLAC]/ | 2026-07-02 23:12 | - | |
| Shania Twain/ | 2026-08-08 08:57 | - | |
| Seventh Day Slumber/ | 2026-08-08 08:57 | - | |
| Scritti Politti/ | 2026-08-08 08:57 | - | |
| Scarface/ | 2026-08-08 09:59 | - | |
| Satie Piano Music & Melodies Reinbert de Leeuw 2006 -/ | 2026-04-02 19:46 | - | |
| Sarah Brightman/ | 2026-08-08 09:58 | - | |
| Samantha Fox/ | 2026-08-08 08:57 | - | |
| Sam Smith/ | 2026-08-08 09:59 | - | |
| Rita Ora/ | 2026-07-08 10:07 | - | |
| Ringo Starr/ | 2026-07-03 02:46 | - | |
| Rick Ross/ | 2026-08-08 08:57 | - | |
| Remix/ | 2025-02-10 23:13 | - | |
| Redman/ | 2026-08-08 08:58 | - | |
| Ramsey Lewis/ | 2026-08-08 08:45 | - | |
| R.E.M_/ | 2026-08-08 08:57 | - | |
| Röyksopp/ | 2026-08-08 08:57 | - | |
| Profiler/ | 2025-02-20 03:59 | - | |
| Prince Rakeem/ | 2026-08-08 08:58 | - | |
| Pola & Bryson/ | 2026-08-08 09:59 | - | |
| Pola & Bryson, goddard_/ | 2026-08-08 08:45 | - | |
| Pola & Bryson, Kelli-Leigh/ | 2026-08-08 08:45 | - | |
| Pola & Bryson, Jelani Blackman/ | 2026-08-08 08:45 | - | |
| Pola & Bryson, IYAMAH/ | 2026-08-08 08:45 | - | |
| Pola & Bryson, Cimone/ | 2026-08-08 08:45 | - | |
| Pola & Bryson & Iyamah/ | 2026-08-08 09:59 | - | |
| Pola & Bryson × Emily Makis/ | 2026-08-08 09:59 | - | |
| Placebo/ | 2026-08-08 08:58 | - | |
| Pink Floyd/ | 2026-08-08 08:44 | - | |
| Pico/ | 2026-08-08 08:44 | - | |
| Pennywise/ | 2026-06-12 17:26 | - | |
| Pearl Jam/ | 2026-08-08 10:00 | - | |
| Paul Simon/ | 2026-08-08 08:59 | - | |
| P1Harmony/ | 2026-08-08 09:00 | - | |
| P!nk/ | 2026-08-08 09:59 | - | |
| Otis Redding/ | 2026-08-08 08:45 | - | |
| Omarion/ | 2026-08-08 09:00 | - | |
| Oasis/ | 2026-08-08 09:00 | - | |
| Nyago/ | 2026-08-08 08:45 | - | |
| Nora En Pure/ | 2026-08-08 08:44 | - | |
| Night Ranger/ | 2026-08-08 09:00 | - | |
| Nickelback/ | 2026-08-08 08:44 | - | |
| Nick Cave & the Bad Seeds/ | 2026-07-02 23:02 | - | |
| New Order/ | 2026-08-08 09:00 | - | |
| Ne-Yo/ | 2026-08-08 09:00 | - | |
| Na Chui/ | 2026-08-08 10:04 | - | |
| Mystic State/ | 2026-08-08 09:01 | - | |
| Mylène Farmer/ | 2026-08-08 09:01 | - | |
| My Chemical Romance/ | 2026-08-08 09:01 | - | |
| Mr. Big/ | 2026-08-08 09:00 | - | |
| Motionless in White/ | 2026-08-08 09:00 | - | |
| Most Relaxing Classical Piano Music in the Universe 2009 -/ | 2026-04-02 19:17 | - | |
| Mos Def/ | 2026-08-08 09:01 | - | |
| Monster Magnet/ | 2026-08-01 03:43 | - | |
| Mitski/ | 2026-08-08 10:00 | - | |
| Minnesota/ | 2026-08-08 09:01 | - | |
| Midge Ure/ | 2026-08-08 08:44 | - | |
| Michael Giacchino/ | 2026-08-07 11:05 | - | |
| Max Richter/ | 2026-08-08 10:04 | - | |
| Mau P/ | 2026-08-08 08:44 | - | |
| Mary J. Blige/ | 2026-08-08 09:03 | - | |
| Maroon 5 featuring Christina Aguilera/ | 2026-08-08 10:04 | - | |
| Markus Masuhr/ | 2026-08-08 08:46 | - | |
| Marilyn Manson/ | 2026-08-08 10:04 | - | |
| Maren Morris/ | 2026-08-08 09:03 | - | |
| Makeup and Vanity Set _ Sferro/ | 2026-08-08 10:01 | - | |
| Luther Vandross/ | 2026-08-08 09:03 | - | |
| Lindstrøm/ | 2026-07-03 02:32 | - | |
| Lindemann feat. Haftbefehl/ | 2026-08-08 09:04 | - | |
| Lindemann/ | 2026-08-08 10:04 | - | |
| Limp Bizkit/ | 2026-08-08 09:04 | - | |
| Lil Wayne/ | 2026-08-08 09:04 | - | |
| Led Zeppelin/ | 2026-08-08 09:05 | - | |
| LL Cool J/ | 2026-08-08 09:05 | - | |
| L.L. Cool J/ | 2026-08-08 10:02 | - | |
| Kyle Dixon & Michael Stein/ | 2026-04-05 00:48 | - | |
| Kovacs/ | 2026-08-08 10:04 | - | |
| King Crimson/ | 2026-08-08 09:05 | - | |
| Kiesza/ | 2026-04-05 00:47 | - | |
| Kevin Gates/ | 2026-08-08 10:02 | - | |
| Keturah and Nyago/ | 2026-08-08 08:45 | - | |
| Keturah/ | 2026-08-08 08:45 | - | |
| Katy Hudson/ | 2026-08-08 09:07 | - | |
| Katatonia/ | 2026-07-25 02:05 | - | |
| Kashus Culpepper/ | 2026-04-05 00:43 | - | |
| Karnivool/ | 2026-08-04 04:09 | - | |
| Karfagen/ | 2026-08-08 08:46 | - | |
| Kanye West/ | 2026-08-08 09:05 | - | |
| KEFASI/ | 2026-08-08 08:45 | - | |
| Justin Bieber/ | 2026-08-08 10:03 | - | |
| Juelz Santana/ | 2026-08-08 09:06 | - | |
| Jon Oliva’s Pain/ | 2026-08-27 22:37 | - | |
| John Williams 1974 Spanish Guitar Music 07 Piano Sonata in D Major, Op. 13/ | 2025-02-17 03:45 | - | |
| John Powell/ | 2026-08-08 09:06 | - | |
| John Mayall & the Bluesbreakers/ | 2026-08-08 09:06 | - | |
| Joel Corry/ | 2026-08-08 08:44 | - | |
| Joanne Shaw Taylor/ | 2026-08-08 08:46 | - | |
| Jason Derulo/ | 2026-08-08 10:03 | - | |
| Jadakiss/ | 2026-08-08 09:07 | - | |
| Jacquees/ | 2026-08-08 09:09 | - | |
| Jack Johnson/ | 2026-08-08 10:03 | - | |
| Ja Rule/ | 2026-08-08 08:45 | - | |
| JUVENILE/ | 2026-08-08 09:05 | - | |
| J.J. Cale/ | 2026-08-15 08:11 | - | |
| Isabel LaRosa/ | 2026-08-08 09:08 | - | |
| Interpol/ | 2026-08-24 17:47 | - | |
| Iggy Pop/ | 2026-08-08 09:08 | - | |
| Ice MC/ | 2026-08-08 09:08 | - | |
| Ice Cube featuring Das EFX/ | 2026-08-08 09:09 | - | |
| Ice Cube/ | 2026-08-08 09:11 | - | |
| IRON MAIDEN/ | 2026-08-08 08:44 | - | |
| ICE MC/ | 2026-08-08 10:03 | - | |
| Howard Jones/ | 2026-07-02 22:58 | - | |
| Hot Since 82/ | 2026-08-08 09:10 | - | |
| Heather Nova/ | 2026-03-29 00:58 | - | |
| Hayley Kiyoko/ | 2026-08-08 09:09 | - | |
| Hard‐Fi/ | 2026-08-08 09:09 | - | |
| Halestorm/ | 2026-04-22 13:34 | - | |
| Haircut One Hundred/ | 2026-08-08 08:46 | - | |
| Grateful Dead/ | 2026-08-08 09:09 | - | |
| Gorillaz/ | 2026-08-08 10:03 | - | |
| Goo Goo Dolls/ | 2026-08-08 10:03 | - | |
| Goma Nyondo/ | 2026-08-08 08:45 | - | |
| Glenn Miller and The Army Air Force Band/ | 2026-08-08 10:02 | - | |
| Glenn Miller/ | 2026-08-08 10:02 | - | |
| Gin Blossoms/ | 2026-08-08 09:11 | - | |
| Gides Chalamanda/ | 2026-08-08 08:45 | - | |
| George Orwell/ | 2026-08-08 08:45 | - | |
| George Acosta/ | 2026-08-08 08:45 | - | |
| Galantis/ | 2026-08-08 09:11 | - | |
| G‐Eazy/ | 2026-08-08 08:46 | - | |
| Future/ | 2026-08-08 09:11 | - | |
| Frank Zappa/ | 2026-08-08 09:12 | - | |
| Forrest Frank/ | 2026-03-29 00:54 | - | |
| FiNCH/ | 2026-07-23 11:17 | - | |
| Feist/ | 2026-08-08 10:04 | - | |
| Fancy Folks & Ian Urbina/ | 2026-08-08 08:57 | - | |
| Europa United/ | 2026-08-08 09:12 | - | |
| Eunice/ | 2026-08-08 08:45 | - | |
| Erik Satie - Piano Music & Melodies/ | 2026-04-02 19:17 | - | |
| Emmylou Harris/ | 2026-08-08 09:14 | - | |
| Elton John/ | 2026-08-08 09:14 | - | |
| Ela Minus/ | 2026-04-21 23:39 | - | |
| Editors/ | 2026-04-21 23:29 | - | |
| Edge of Sanity/ | 2026-04-02 19:16 | - | |
| Durante/ | 2026-08-08 09:14 | - | |
| Dua Lipa/ | 2026-08-08 10:01 | - | |
| Dropkick Murphys/ | 2026-08-15 15:10 | - | |
| Drive‐By Truckers/ | 2026-04-21 22:32 | - | |
| Djo/ | 2026-08-08 09:14 | - | |
| Disturbed/ | 2026-08-08 10:01 | - | |
| Dio/ | 2026-07-27 02:17 | - | |
| Deftones/ | 2026-08-08 09:15 | - | |
| David Tudor - 1996 - Piano Avant-Garde Recordings 1956-1960 [FLAC]/ | 2026-04-02 19:16 | - | |
| Danko Jones/ | 2025-06-26 14:16 | - | |
| Damien Jurado/ | 2025-06-27 15:11 | - | |
| DJ Khaled/ | 2026-08-08 09:15 | - | |
| DITZ/ | 2025-03-02 22:11 | - | |
| Crowded House/ | 2026-08-08 09:15 | - | |
| Count Basie and His Orchestra/ | 2026-08-08 09:56 | - | |
| Count Basie And His Orchestra/ | 2026-08-08 08:44 | - | |
| Count Basie & His Orchestra/ | 2026-08-08 09:17 | - | |
| Coldplay/ | 2026-08-08 10:00 | - | |
| Cody Johnson/ | 2026-08-08 09:17 | - | |
| Clutch/ | 2025-07-25 13:06 | - | |
| Chuckyy/ | 2025-11-05 19:14 | - | |
| Chuckie & Promise Land Feat. Amanda Wilson/ | 2026-08-08 08:44 | - | |
| Chicane/ | 2026-08-08 08:45 | - | |
| Carly Simon/ | 2026-08-08 09:17 | - | |
| CRi/ | 2026-04-24 05:13 | - | |
| Céline Dion/ | 2026-08-08 09:17 | - | |
| Bubba Sparxxx/ | 2026-08-08 09:50 | - | |
| Bronski Beat/ | 2026-08-08 09:50 | - | |
| Boytronic/ | 2026-08-08 10:04 | - | |
| Boy Bruynzeel/ | 2026-08-08 10:04 | - | |
| BossMan Dlow/ | 2026-08-08 09:50 | - | |
| Boniface Ndamera and The Lucky Stars/ | 2026-08-08 08:45 | - | |
| Bob Moses/ | 2026-08-08 09:50 | - | |
| Bob Dylan/ | 2026-08-08 10:00 | - | |
| Blind Guardian/ | 2026-08-05 04:17 | - | |
| Black Sabbath featuring Tony Iommi/ | 2026-08-08 09:59 | - | |
| Black Label Society/ | 2026-05-07 11:53 | - | |
| Billy Vaughn and His Orchestra/ | 2026-08-08 09:57 | - | |
| Ben Mankhamba/ | 2026-08-08 08:45 | - | |
| Barry White/ | 2026-08-08 09:58 | - | |
| Bananarama/ | 2026-08-08 08:45 | - | |
| BTS/ | 2026-08-08 09:53 | - | |
| BT/ | 2026-08-08 09:52 | - | |
| BIA/ | 2026-08-08 09:52 | - | |
| B.B. King/ | 2026-08-08 09:57 | - | |
| Avenged Sevenfold/ | 2026-08-08 09:53 | - | |
| Asake/ | 2026-08-08 09:53 | - | |
| Art of Noise/ | 2026-08-27 20:18 | - | |
| Armin van Buuren/ | 2026-08-08 08:44 | - | |
| Aqua/ | 2026-08-08 09:53 | - | |
| Anyma/ | 2026-05-24 02:16 | - | |
| Andrea Bocelli feat. Jannik Sinner/ | 2026-08-08 09:58 | - | |
| Andrea Bocelli/ | 2026-08-08 09:58 | - | |
| America/ | 2026-08-08 09:53 | - | |
| Alphaville/ | 2026-05-20 04:53 | - | |
| Allen Toussaint/ | 2026-08-08 09:58 | - | |
| Alien Ant Farm/ | 2026-08-08 09:57 | - | |
| Alessandro.Simonetto-The.Original.Laurel.&.Hardy.Piano.Music.2017.[24-88]/ | 2025-03-21 03:28 | - | |
| Albert King/ | 2026-08-08 09:54 | - | |
| Akon/ | 2026-08-08 09:57 | - | |
| Aerosmith/ | 2026-08-08 09:56 | - | |
| Adventure Club/ | 2026-08-08 09:55 | - | |
| Adele/ | 2026-08-08 09:55 | - | |
| Action Bronson/ | 2026-08-08 09:55 | - | |
| Above & Beyond/ | 2026-08-08 09:55 | - | |
| ABC/ | 2026-08-08 09:55 | - | |
| 1000mods/ | 2026-08-03 03:19 | - | |
| 50 Cent/ | 2026-08-08 09:56 | - | |
![[SND]](/icons/sound2.gif) | Peter Gabriel - Live at WOMAD 1982 (PGCD23).flac | 2026-08-08 08:44 | 349M | |
![[TXT]](/icons/text.gif) | lidarr_write_test.txt | 2024-04-13 05:35 | 0 | |
|
|---|