![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[IMG]](cdart.png){kind=small}
![[IMG]](discart.png){kind=small}
![[IMG]](cover.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2025-12-20 00:49 | 5.6K | |
| folder.jpg | 2024-10-06 23:04 | 107K | |
| cdart.png | 2022-12-04 17:43 | 608K | |
| discart.png | 2022-07-13 21:19 | 608K | |
| cover.jpg | 2025-09-06 22:26 | 12M | |
| 11 The End.flac | 2025-09-07 21:55 | 17M | |
| 13 [seagulls].flac | 2025-09-07 22:32 | 18M | |
| 07 No Child of Mine.flac | 2025-09-07 20:06 | 18M | |
| 12 The Desperate Kingdom of Love.flac | 2025-09-07 22:13 | 24M | |
| 09 You Come Through.flac | 2025-09-07 20:58 | 25M | |
| 03 Who the Fuck_.flac | 2025-09-07 17:46 | 25M | |
| 02 Shame.flac | 2025-09-07 17:10 | 26M | |
| 08 Cat on the Wall.flac | 2025-09-07 20:25 | 29M | |
| 06 The Slow Drug.flac | 2025-09-07 19:24 | 31M | |
| 05 The Letter.flac | 2025-09-07 18:50 | 32M | |
| 04 Pocket Knife.flac | 2025-09-07 18:13 | 35M | |
| 14 The Darker Days of Me & Him.flac | 2025-09-07 22:41 | 35M | |
| 10 It's You.flac | 2025-09-07 21:19 | 35M | |
| 01 The Life & Death of Mr. Badmouth.flac | 2025-09-07 16:23 | 37M | |