![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](logo.png){kind=logo}
![[IMG]](folder.jpg){kind=small}
![[IMG]](cover.jpg){kind=small}
![[IMG]](clearlogo.png){kind=small}
![[IMG]](banner.jpg){kind=small}
![[IMG]](backdrop1.jpg){kind=small}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| logo.png | 2024-10-06 23:02 | 43K | |
| folder.jpg | 2024-10-06 23:02 | 71K | |
| cover.jpg | 2025-09-06 21:36 | 6.5M | |
| clearlogo.png | 2024-02-24 11:33 | 104K | |
| banner.jpg | 2024-10-06 23:02 | 153K | |
| backdrop1.jpg | 2024-10-06 23:02 | 328K | |
| album.nfo | 2025-12-20 00:26 | 2.5K | |
| 12 Find Life.flac | 2025-09-07 22:05 | 44M | |
| 11 Resistance.flac | 2025-09-07 21:43 | 43M | |
| 10 Outer Dimensions.flac | 2025-09-07 21:17 | 45M | |
| 09 Breaking the Waves.flac | 2025-09-07 20:49 | 47M | |
| 08 Ecstasy.flac | 2025-09-07 20:20 | 44M | |
| 07 Stay a Little While.flac | 2025-09-07 19:49 | 47M | |
| 06 Interference.flac | 2025-09-07 19:18 | 46M | |
| 05 Re-Vision.flac | 2025-09-07 18:45 | 44M | |
| 04 Liberated.flac | 2025-09-07 18:10 | 45M | |
| 03 Damnation Flame.flac | 2025-09-07 17:33 | 50M | |
| 02 Insatiable.flac | 2025-09-07 16:59 | 44M | |
| 01 The Catalyst.flac | 2025-09-07 16:19 | 51M | |