![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](cover.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 L.A. Nights.flac | 2025-09-07 16:25 | 33M | |
| 02 What About Us.flac | 2025-09-07 17:00 | 41M | |
| 03 Swept Away.flac | 2025-09-07 17:36 | 41M | |
| 04 A New Day.flac | 2025-09-07 18:14 | 33M | |
| 05 My Everything.flac | 2025-09-07 18:47 | 37M | |
| 06 Summervibes with 9PM.flac | 2025-09-07 19:20 | 40M | |
| 07 Gravity.flac | 2025-09-07 19:51 | 40M | |
| 08 Luminescence.flac | 2025-09-07 20:27 | 28M | |
| 09 Behind.flac | 2025-09-07 20:54 | 30M | |
| 10 Future Memories.flac | 2025-09-07 21:18 | 39M | |
| 11 Still Here.flac | 2025-09-07 21:44 | 36M | |
| 12 My Saving Grace.flac | 2025-09-07 22:09 | 29M | |
| 13 Terra 260273.flac | 2025-09-07 22:25 | 39M | |
| 14 Communicate.flac | 2025-09-07 22:42 | 27M | |
| 15 Talismanic.flac | 2025-09-07 22:54 | 30M | |
| 16 Missing.flac | 2025-09-07 23:06 | 27M | |
| 17 Horizon.flac | 2025-09-07 23:14 | 35M | |
| 18 Voices.flac | 2025-09-07 23:23 | 24M | |
| 19 Behind Ambient (ATB's Ambient Version).flac | 2025-09-07 23:29 | 22M | |
| 20 Authentic Reaction.flac | 2025-09-07 23:34 | 25M | |
| 21 Careless.flac | 2025-09-07 23:36 | 43M | |
| 22 Twilight.flac | 2025-09-07 23:39 | 40M | |
| 23 Listen to Me.flac | 2025-09-07 23:41 | 22M | |
| 24 Living Life Over.flac | 2025-09-07 23:42 | 33M | |
| 25 Silent Meaning.flac | 2025-09-07 23:43 | 33M | |
| 26 Malibu Road.flac | 2025-09-07 23:44 | 23M | |
| album.nfo | 2025-12-19 19:57 | 5.6K | |
| cover.jpg | 2025-09-06 18:44 | 307K | |