![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](backdrop1.jpg){kind=small}
![[IMG]](logo.png){kind=logo}
![[IMG]](banner.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
![[IMG]](clearlogo.png){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2025-11-15 00:47 | 3.1K | |
| 09 Is It Now_.flac | 2025-09-10 22:12 | 33M | |
| 08 Profiteers.flac | 2025-09-10 21:03 | 27M | |
| 07 Stand in Line.flac | 2025-09-10 19:26 | 36M | |
| 06 No Reaction.flac | 2025-09-10 18:22 | 22M | |
| 05 Koala Sprint.flac | 2025-09-10 16:17 | 33M | |
| 04 Back on the Borderline.flac | 2025-09-10 15:23 | 24M | |
| 03 Naked Flame.flac | 2025-09-10 13:54 | 25M | |
| 02 Section 5 (Bus to Bondi).flac | 2025-09-10 12:38 | 22M | |
| 01 Cold Cold Change.flac | 2025-09-10 10:26 | 26M | |
| backdrop1.jpg | 2024-10-07 03:34 | 115K | |
| logo.png | 2024-10-07 03:34 | 127K | |
| banner.jpg | 2024-10-07 03:33 | 74K | |
| folder.jpg | 2024-10-07 03:33 | 147K | |
| clearlogo.png | 2024-02-25 11:44 | 61K | |