![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[IMG]](cdart.png){kind=small}
![[IMG]](discart.png){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-01-10 03:21 | 8.6K | |
| folder.jpg | 2024-10-06 15:03 | 99K | |
| cdart.png | 2022-10-22 05:32 | 830K | |
| discart.png | 2022-06-03 18:59 | 830K | |
| 01 Vertigo.mp3 | 2025-09-26 07:08 | 5.9M | |
| 09 One Step Closer.mp3 | 2025-09-26 07:09 | 6.2M | |
| 12 Fast Cars.mp3 | 2025-09-26 07:09 | 6.3M | |
| 02 Miracle Drug.mp3 | 2025-09-26 07:08 | 6.4M | |
| 06 All Because of You.mp3 | 2025-09-26 07:08 | 6.8M | |
| 07 A Man and a Woman.mp3 | 2025-09-26 07:09 | 7.0M | |
| 11 Yahweh.mp3 | 2025-09-26 07:09 | 7.8M | |
| 10 Original of the Species.mp3 | 2025-09-26 07:09 | 8.1M | |
| 03 Sometimes You Can't Make It on Your Own.mp3 | 2025-09-26 07:08 | 8.3M | |
| 04 Love and Peace or Else.mp3 | 2025-09-26 07:08 | 8.5M | |
| 08 Crumbs From Your Table.mp3 | 2025-09-26 07:09 | 8.9M | |
| 05 City of Blinding Lights.mp3 | 2025-09-26 07:08 | 9.8M | |