![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Sound the Alarm.flac | 2025-09-26 07:56 | 25M | |
| 02 Mandala.flac | 2025-09-26 07:56 | 27M | |
| 03 Radio Retaliation.flac | 2025-09-26 07:56 | 22M | |
| 04 Vampires.flac | 2025-09-26 07:56 | 33M | |
| 05 Hare Krsna.flac | 2025-09-26 07:56 | 24M | |
| 06 El Pueblo Unido.flac | 2025-09-26 07:56 | 24M | |
| 07 (The Forgotten People).flac | 2025-09-26 07:56 | 21M | |
| 08 33_.flac | 2025-09-26 07:56 | 25M | |
| 09 Beautiful Drug.flac | 2025-09-26 07:56 | 20M | |
| 10 La Femme Parallel.flac | 2025-09-26 07:56 | 30M | |
| 11 Retaliation Suite.flac | 2025-09-26 07:56 | 19M | |
| 12 The Numbers Game.flac | 2025-09-26 07:56 | 22M | |
| 13 The Shining Path.flac | 2025-09-26 07:56 | 22M | |
| 14 Blasting Through the City.flac | 2025-09-26 07:56 | 23M | |
| 15 Sweet Tides.flac | 2025-09-26 07:56 | 30M | |
| album.nfo | 2026-01-10 22:35 | 3.5K | |