![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](clearlogo.png){kind=small}
![[IMG]](folder.jpg){kind=small}
![[IMG]](logo.png){kind=logo}
![[IMG]](banner.jpg){kind=small}
![[IMG]](backdrop1.jpg){kind=small}
![[IMG]](fanart.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Direction Reaction Creation (1997)/ | 2024-10-06 19:33 | - | |
| Direction Reaction Creation/ | 2025-09-26 09:31 | - | |
| Setting Sons (1979)/ | 2024-12-29 20:01 | - | |
| Setting Sons/ | 2024-12-29 20:10 | - | |
| Snap! (1983)/ | 2022-10-22 09:23 | - | |
| Snap!/ | 2025-09-26 09:31 | - | |
| Sound Affects (1980)/ | 2024-12-29 20:02 | - | |
| Sound Affects/ | 2024-12-29 20:11 | - | |
| The Gift (1982)/ | 2022-10-22 09:24 | - | |
| The Gift/ | 2025-09-26 09:31 | - | |
| This Is the Modern World (1977)/ | 2024-12-29 20:02 | - | |
| This Is the Modern World/ | 2024-12-29 20:10 | - | |
| artist.nfo | 2026-01-11 17:36 | 4.5K | |
| clearlogo.png | 2024-03-02 12:29 | 66K | |
| folder.jpg | 2024-10-06 19:32 | 108K | |
| logo.png | 2024-10-06 19:32 | 136K | |
| banner.jpg | 2024-10-06 19:32 | 147K | |
| backdrop1.jpg | 2024-10-06 19:32 | 240K | |
| fanart.jpg | 2024-03-11 17:30 | 1.0M | |