![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Drug Machine in Heaven.flac | 2025-09-26 09:40 | 16M | |
| 02 Right Now.flac | 2025-09-26 09:40 | 25M | |
| 03 Michael, Time to Wake Up.flac | 2025-09-26 09:40 | 2.2M | |
| 04 Chrome Plated Suicide.flac | 2025-09-26 09:40 | 40M | |
| 05 Hari-Krishna Stomp Wagon (Fuck Led Zeppelin).flac | 2025-09-26 09:40 | 27M | |
| 06 Miracle on 42nd Street.flac | 2025-09-26 09:40 | 10M | |
| 07 Fryin' Up.flac | 2025-09-26 09:40 | 20M | |
| 08 Hell's Angels Cracker Factory.flac | 2025-09-26 09:40 | 150M | |
| 09 U.F.O. Story.flac | 2025-09-26 09:40 | 31M | |
| 10 Redneck School of Technology.flac | 2025-09-26 09:40 | 19M | |
| 11 Shaved Gorilla.flac | 2025-09-26 09:40 | 17M | |
| 12 The Spontaneous Combustion of John.flac | 2025-09-26 09:40 | 3.6M | |
| 13 The Last Drop of Morning Dew.flac | 2025-09-26 09:40 | 14M | |
| 14 Begs and Achin'.flac | 2025-09-26 09:40 | 28M | |
| album.nfo | 2026-01-11 00:46 | 6.7K | |
| folder.jpg | 2024-10-06 17:57 | 154K | |