![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](folder.jpg){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| folder.jpg | 2024-10-06 17:58 | 138K | |
| 1-01 Shine on Sweet Jesus - Jesus Song No. 5.flac | 2025-09-26 09:41 | 31M | |
| 1-02 Unconsciously Screamin'.flac | 2025-09-26 09:41 | 31M | |
| 1-03 Rainin' Babies.flac | 2025-09-26 09:41 | 31M | |
| 1-04 Take Meta Mars.flac | 2025-09-26 09:41 | 20M | |
| 1-05 Five Stop Mother Superior Rain.flac | 2025-09-26 09:42 | 41M | |
| 1-06 Stand in Line.flac | 2025-09-26 09:42 | 25M | |
| 1-07 God Walks Among Us Now - Jesus Song No. 6.flac | 2025-09-26 09:42 | 37M | |
| 1-08 There You Are - Jesus Song No. 7.flac | 2025-09-26 09:42 | 28M | |
| 1-09 Mountain Side.flac | 2025-09-26 09:42 | 51M | |
| 1-10 What a Wonderful World.flac | 2025-09-26 09:42 | 22M | |
| 2-01 Lucifer Rising.flac | 2025-09-26 09:42 | 27M | |
| 2-02 Ma, I Didn't Notice.flac | 2025-09-26 09:42 | 54M | |
| 2-03 Let Me Be It.flac | 2025-09-26 09:42 | 38M | |
| 2-04 Drug Machine.flac | 2025-09-26 09:42 | 21M | |
| 2-05 Strychnine_Peace, Love and Understanding.flac | 2025-09-26 09:42 | 29M | |
| album.nfo | 2026-01-11 00:45 | 6.6K | |