![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](discart.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 02-10 All the Young Punks (New Boots and Contracts).flac | 2025-09-26 10:05 | 112M | |
| 02-09 Cheapskates.flac | 2025-09-26 10:05 | 78M | |
| 02-08 Stay Free.flac | 2025-09-26 10:05 | 83M | |
| 02-07 Drug-Stabbing Time.flac | 2025-09-26 10:05 | 84M | |
| 02-06 Guns on the Roof.flac | 2025-09-26 10:05 | 73M | |
| 02-05 Last Gang in Town.flac | 2025-09-26 10:05 | 121M | |
| 02-04 Julie's Been Working for the Drug Squad.flac | 2025-09-26 10:05 | 69M | |
| 02-03 Tommy Gun.flac | 2025-09-26 10:05 | 75M | |
| 02-02 English Civil War.flac | 2025-09-26 10:05 | 58M | |
| 02-01 Safe European Home.flac | 2025-09-26 10:05 | 88M | |
| discart.jpg | 2025-06-15 05:00 | 185K | |
| folder.jpg | 2025-06-15 05:00 | 364K | |