![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](cdart.png){kind=small}
![[IMG]](discart.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Leave Home.flac | 2025-01-25 20:05 | 37M | |
| 02 In Dust We Trust.flac | 2025-01-26 07:46 | 36M | |
| 03 Song to the Siren.flac | 2025-02-17 06:55 | 21M | |
| 04 Three Little Birdies Down Beats.flac | 2025-02-17 12:56 | 39M | |
| 05 Fuck Up Beats.flac | 2025-02-18 03:13 | 10M | |
| 06 Chemical Beats.flac | 2025-02-18 07:59 | 30M | |
| 07 Chico’s Groove.flac | 2025-02-18 15:27 | 32M | |
| 08 One Too Many Mornings.flac | 2025-02-19 00:26 | 25M | |
| 09 Life Is Sweet.flac | 2025-02-19 06:00 | 42M | |
| 10 Playground for a Wedgeless Firm.flac | 2025-02-19 17:35 | 14M | |
| 11 Alive Alone.flac | 2025-02-19 21:18 | 33M | |
| album.nfo | 2026-01-03 08:54 | 5.2K | |
| cdart.png | 2022-10-23 17:55 | 246K | |
| discart.jpg | 2023-07-15 11:45 | 278K | |
| folder.jpg | 2024-10-06 14:20 | 91K | |