![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](backdrop.jpg){kind=small}
![[IMG]](backdrop8.jpg){kind=small}
![[IMG]](logo.png){kind=logo}
![[IMG]](banner.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
![[IMG]](clearlogo.png){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| The Chemical Brothers Remixes/ | 2025-02-16 00:52 | - | |
| Swoon/ | 2025-01-23 22:03 | - | |
| Star Guitar/ | 2025-01-23 22:03 | - | |
| Block Rockin’ Beats/ | 2025-01-23 22:02 | - | |
| Singles 93-03/ | 2025-01-23 22:01 | - | |
| Music_Response/ | 2025-01-23 21:59 | - | |
| Music_ Response/ | 2025-01-23 21:59 | - | |
| Live at The Social, Volume 1/ | 2025-01-23 21:59 | - | |
| Galvanize/ | 2025-01-23 21:58 | - | |
| Hanna/ | 2025-01-23 21:58 | - | |
| Get Yourself High/ | 2025-01-23 21:57 | - | |
| Further/ | 2025-01-23 21:57 | - | |
| Exit Planet Dust/ | 2025-01-23 21:57 | - | |
| Do It Again/ | 2025-01-23 21:56 | - | |
| Dig Your Own Hole/ | 2025-01-23 21:56 | - | |
| Brothers Gonna Work It Out/ | 2025-01-23 21:55 | - | |
| Come With Us/ | 2025-01-23 21:55 | - | |
| Brotherhood/ | 2025-01-23 21:54 | - | |
| Block Rockin' Beats/ | 2025-01-23 21:53 | - | |
| Another World/ | 2025-01-23 21:53 | - | |
| For That Beautiful Feeling/ | 2024-12-29 18:52 | - | |
| Born in the Echoes/ | 2024-12-29 18:52 | - | |
| No Geography/ | 2024-12-29 18:51 | - | |
| Go/ | 2024-12-29 18:51 | - | |
| Go (2015)/ | 2024-12-29 18:44 | - | |
| Surrender/ | 2024-12-29 18:43 | - | |
| No Geography (2019)/ | 2024-12-29 18:42 | - | |
| Elektrobank/ | 2024-12-29 18:41 | - | |
| Further (2010)/ | 2024-12-29 18:41 | - | |
| For That Beautiful Feeling (2023)/ | 2024-12-29 18:41 | - | |
| Born in the Echoes (2015)/ | 2024-10-06 14:21 | - | |
| Surrender (1999)/ | 2024-10-06 14:20 | - | |
| The Salmon Dance/ | 2023-07-15 11:45 | - | |
| It Began in Afrika/ | 2023-07-15 11:45 | - | |
| The Chemical Brothers/ | 2023-07-15 11:45 | - | |
| Midnight Madness/ | 2023-07-15 11:45 | - | |
| Come With Us _ The Test/ | 2023-07-15 11:45 | - | |
| Let Forever Be/ | 2023-07-15 11:45 | - | |
| The Test/ | 2023-07-15 11:45 | - | |
| Leave Home/ | 2023-07-15 11:45 | - | |
| Believe/ | 2023-07-15 11:45 | - | |
| Setting Sun/ | 2023-07-15 11:45 | - | |
| American EP/ | 2023-07-15 11:45 | - | |
| The Private Psychedelic Reel/ | 2023-07-15 11:45 | - | |
| Radio 1 Anti-Nazi Mix _ Interview/ | 2023-07-15 11:45 | - | |
| We Are the Night/ | 2022-10-23 18:12 | - | |
| Push the Button/ | 2022-10-23 17:59 | - | |
| Hey Boy Hey Girl (Soulwax remix)/ | 2022-10-23 17:43 | - | |
| Greatest Hits/ | 2022-08-11 07:01 | - | |
| The Boxer/ | 2022-08-11 07:01 | - | |
| Life Is Sweet/ | 2022-08-11 06:59 | - | |
| Hey Boy Hey Girl/ | 2022-08-11 06:58 | - | |
| Loops of Fury/ | 2022-08-11 06:58 | - | |
| The Remixes, Volume 6/ | 2022-08-11 06:58 | - | |
| Out of Control/ | 2022-08-11 06:58 | - | |
| B-Sides/ | 2022-08-11 06:58 | - | |
| artist.nfo | 2026-01-09 22:03 | 11K | |
| 11.flac | 2025-09-25 09:53 | 392K | |
| 03.flac | 2025-09-25 09:53 | 845K | |
| backdrop.jpg | 2025-02-03 09:33 | 98K | |
| backdrop8.jpg | 2024-10-06 14:18 | 98K | |
| logo.png | 2024-10-06 14:18 | 82K | |
| banner.jpg | 2024-10-06 14:18 | 40K | |
| folder.jpg | 2024-10-06 14:18 | 61K | |
| clearlogo.png | 2024-02-25 11:54 | 112K | |