![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](discart.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
![[IMG]](discart.png){kind=small}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-01-08 05:50 | 2.4K | |
| discart.jpg | 2023-07-15 11:13 | 208K | |
| folder.jpg | 2023-07-15 11:13 | 432K | |
| discart.png | 2024-07-19 04:14 | 715K | |
| 07 Make Sure You're Sure.mp3 | 2025-02-26 23:35 | 3.6M | |
| 09 I Go Sailing.mp3 | 2025-02-27 02:03 | 4.1M | |
| 11 Lighting Up the Candles.mp3 | 2025-02-27 04:26 | 4.2M | |
| 04 Each Other's Throat.mp3 | 2025-02-26 19:37 | 4.3M | |
| 01 Fun Day.mp3 | 2025-02-26 15:15 | 4.7M | |
| 02 Queen in the Black.mp3 | 2025-02-26 16:39 | 4.8M | |
| 03 These Three Words.mp3 | 2025-02-26 18:07 | 4.9M | |
| 08 Jungle Fever.mp3 | 2025-02-27 00:49 | 4.9M | |
| 05 If She Breaks Your Heart.mp3 | 2025-02-26 20:57 | 5.1M | |
| 06 Gotta Have You.mp3 | 2025-02-26 22:14 | 6.3M | |
| 10 Chemical Love.flac | 2025-02-19 15:31 | 27M | |