![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](cdart.png){kind=small}
![[IMG]](discart.png){kind=small}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 The Ballad of Mona Lisa.flac | 2025-01-25 22:26 | 27M | |
| 02 Let’s Kill Tonight.flac | 2025-01-26 09:45 | 27M | |
| 03 Hurricane.flac | 2025-02-17 04:04 | 33M | |
| 04 Memories.flac | 2025-02-17 14:56 | 26M | |
| 05 Trade Mistakes.flac | 2025-02-17 22:42 | 27M | |
| 06 Ready to Go (Get Me Out of My Mind).flac | 2025-02-18 08:42 | 27M | |
| 07 Always.flac | 2025-02-18 17:46 | 19M | |
| 08 The Calendar.flac | 2025-02-18 22:36 | 34M | |
| 09 Sarah Smiles.flac | 2025-02-19 07:41 | 27M | |
| 10 Nearly Witches (Ever Since We Met…).flac | 2025-02-19 14:53 | 31M | |
| 11 Kaleidoscope Eyes.flac | 2025-02-19 22:29 | 25M | |
| 12 Stall Me.flac | 2025-02-23 15:40 | 23M | |
| 13 Oh Glory (Demo).flac | 2025-02-23 20:43 | 24M | |
| 14 I Wanna Be Free.flac | 2025-02-24 01:11 | 21M | |
| 15 Turn Off the Lights.flac | 2025-02-24 04:07 | 30M | |
| album.nfo | 2026-01-10 09:41 | 8.4K | |
| cdart.png | 2022-10-22 06:02 | 619K | |
| discart.png | 2022-06-03 11:22 | 619K | |
| folder.jpg | 2024-10-06 16:04 | 122K | |