![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-01-10 14:28 | 4.1K | |
| 14 Only Memories Remain (Jim Demo).flac | 2025-02-24 00:38 | 26M | |
| 13 I Can't Wait.flac | 2025-02-23 20:48 | 23M | |
| 12 Compound Fracture (Miami Jungle Version).flac | 2025-02-20 03:44 | 29M | |
| 11 Hillside Song.flac | 2025-02-19 23:52 | 13M | |
| 10 Only Memories Remain.flac | 2025-02-19 13:59 | 42M | |
| 09 Tropics (Erase Traces).flac | 2025-02-19 06:55 | 32M | |
| 08 Big Decisions.flac | 2025-02-18 23:58 | 26M | |
| 07 Thin Line.flac | 2025-02-18 16:12 | 28M | |
| 06 Spring (Among the Living).flac | 2025-02-18 06:53 | 40M | |
| 05 Get the Point.flac | 2025-02-18 00:53 | 18M | |
| 04 In Its Infancy (The Waterfall).flac | 2025-02-17 13:24 | 34M | |
| 03 Like a River.flac | 2025-02-17 04:38 | 31M | |
| 02 Compound Fracture.flac | 2025-01-26 10:29 | 25M | |
| 01 Believe (Nobody Knows).flac | 2025-01-25 20:49 | 33M | |