![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Barracuda - Besame.flac | 2025-01-25 23:04 | 25M | |
| 02 Brainstorm - Rock the House.flac | 2025-01-26 08:30 | 32M | |
| 03 Brainstorm - Move the Colors.flac | 2025-02-17 06:18 | 24M | |
| 04 U.H.F. - UHF3.flac | 2025-02-17 13:08 | 37M | |
| 05 Barracuda - Party Time.flac | 2025-02-17 22:14 | 29M | |
| 06 U.H.F. - Protect Write.flac | 2025-02-18 07:05 | 38M | |
| 07 Moby - Go (original).flac | 2025-02-18 14:40 | 39M | |
| 08 Voodoo Child - Permanent Green.flac | 2025-02-18 22:43 | 34M | |
| 09 Voodoo Child - Voodoo Child.flac | 2025-02-19 07:20 | 30M | |
| 10 Barracuda - Drug Fits the Face.flac | 2025-02-19 16:09 | 25M | |
| 11 Moby - Time Signature.flac | 2025-02-19 22:27 | 25M | |
| 12 U.H.F. - Peacehead.flac | 2025-02-20 03:12 | 34M | |
| 13 Barracuda - Barracuda.flac | 2025-02-23 19:19 | 45M | |
| 14 Moby - Mobility.flac | 2025-02-24 00:04 | 34M | |
| 15 Voodoo Child - M-Four.flac | 2025-02-24 05:38 | 11M | |
| album.nfo | 2026-01-10 16:59 | 2.9K | |