![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2026-01-13 07:21 | 2.8K | |
| 14 Papa Said.flac | 2025-02-24 00:12 | 31M | |
| 13 Satisfied.flac | 2025-02-23 20:25 | 26M | |
| 12 C'mon In.flac | 2025-02-23 15:10 | 26M | |
| 11 Money.flac | 2025-02-19 22:20 | 25M | |
| 10 Dreadlock Refugee.flac | 2025-02-19 15:54 | 25M | |
| 09 Indepedence Day.flac | 2025-02-19 07:28 | 28M | |
| 08 Love Is a Drug.flac | 2025-02-18 22:30 | 35M | |
| 07 All That Matters.flac | 2025-02-18 16:54 | 24M | |
| 06 Power of Music.flac | 2025-02-18 07:43 | 31M | |
| 05 Poof - You're Gone!.flac | 2025-02-17 23:59 | 22M | |
| 04 Wrong or Right.flac | 2025-02-17 15:27 | 23M | |
| 03 You Showed Me.flac | 2025-02-17 05:47 | 25M | |
| 02 Plano-Texas-USA.flac | 2025-01-26 09:45 | 26M | |
| 01 Perfect Love.flac | 2025-01-25 23:13 | 24M | |