![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](discart.jpg){kind=small}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Hello Dolly.flac | 2025-01-26 01:14 | 17M | |
| 02 Jeepers Creepers.flac | 2025-01-26 14:05 | 8.0M | |
| 03 Georgia on My Mind.flac | 2025-02-17 07:11 | 19M | |
| 04 Blueberry Hill.flac | 2025-02-17 16:55 | 14M | |
| 05 Baby Won't You Please Come Home.flac | 2025-02-18 00:43 | 18M | |
| 06 When You're Smiling (The Whole World Smiles With You).flac | 2025-02-18 09:08 | 24M | |
| 07 Struttin' With Some Barbeque.flac | 2025-02-18 18:33 | 12M | |
| 08 Lazy River.flac | 2025-02-19 01:29 | 19M | |
| 09 Heebie Jeebies.flac | 2025-02-19 09:47 | 15M | |
| 10 I Still Get Jealous.flac | 2025-02-19 17:31 | 15M | |
| album.nfo | 2026-01-10 14:48 | 4.7K | |
| discart.jpg | 2023-07-15 08:17 | 270K | |
| folder.jpg | 2023-07-15 08:17 | 324K | |