![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 How Do You Speak to an Angel.flac | 2025-01-25 21:53 | 28M | |
| 02 My Old Man.flac | 2025-01-26 11:10 | 21M | |
| 03 Keep Away.flac | 2025-02-17 06:15 | 24M | |
| 04 Growing Up in Public.flac | 2025-02-17 16:20 | 18M | |
| 05 Standing on Ceremony.flac | 2025-02-17 23:24 | 24M | |
| 06 So Alone.flac | 2025-02-18 08:41 | 26M | |
| 07 Love Is Here to Stay.flac | 2025-02-18 17:26 | 21M | |
| 08 The Power of Positive Drinking.flac | 2025-02-19 02:13 | 14M | |
| 09 Smiles.flac | 2025-02-19 09:31 | 17M | |
| 10 Think It Over.flac | 2025-02-19 16:56 | 19M | |
| 11 Teach the Gifted Children.flac | 2025-02-19 23:15 | 19M | |
| album.nfo | 2026-01-10 08:47 | 3.3K | |