![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2025-12-14 02:00 | 12K | |
| 04 Empty Spaces.flac | 2025-02-17 18:53 | 4.1M | |
| 02 The Radiance.flac | 2025-01-26 12:42 | 13M | |
| 13 Fallout.flac | 2025-02-23 21:31 | 15M | |
| 11 Wisdom, Justice, and Love.flac | 2025-02-19 23:29 | 17M | |
| 07 Jornada del Muerto.flac | 2025-02-18 17:41 | 20M | |
| 01 The Requiem.flac | 2025-01-26 00:19 | 21M | |
| 15 The Messenger.flac | 2025-02-24 03:59 | 33M | |
| 08 Waiting for the End.flac | 2025-02-18 21:41 | 50M | |
| 10 Wretches and Kings.flac | 2025-02-19 13:39 | 52M | |
| 03 Burning in the Skies.flac | 2025-01-26 18:01 | 53M | |
| 06 Robot Boy.flac | 2025-02-18 06:16 | 57M | |
| 09 Blackout.flac | 2025-02-19 05:28 | 59M | |
| 12 Iridescent.flac | 2025-02-20 02:28 | 60M | |
| 05 When They Come for Me.flac | 2025-02-17 20:01 | 63M | |
| 14 The Catalyst.flac | 2025-02-23 23:25 | 71M | |