![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](cdart.png){kind=small}
![[IMG]](discart.png){kind=small}
![[IMG]](folder.jpg){kind=small}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Light.mp3 | 2025-01-26 04:14 | 5.9M | |
| 02 A Drug Against War.mp3 | 2025-01-26 15:03 | 3.7M | |
| 03 Blood (Evil mix).mp3 | 2025-02-17 10:19 | 5.1M | |
| 04 Lust.mp3 | 2025-02-17 18:49 | 4.3M | |
| 05 Glory.mp3 | 2025-02-18 04:55 | 3.9M | |
| 06 Move On.mp3 | 2025-02-18 12:37 | 5.4M | |
| 07 No Peace.mp3 | 2025-02-18 20:18 | 4.4M | |
| 08 A Hole in the Wall.mp3 | 2025-02-19 04:06 | 5.7M | |
| 09 Sucks.mp3 | 2025-02-19 12:36 | 3.5M | |
| 10 The Problem.mp3 | 2025-02-19 19:14 | 5.9M | |
| album.nfo | 2026-01-11 22:55 | 5.0K | |
| cdart.png | 2022-10-22 09:45 | 614K | |
| discart.png | 2022-06-03 10:41 | 614K | |
| folder.jpg | 2024-10-06 19:58 | 165K | |