![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Stone in Love.flac | 2025-01-25 19:00 | 53M | |
| 02 After the Fall.flac | 2025-01-26 06:17 | 62M | |
| 03 Chain Reaction.flac | 2025-01-26 17:53 | 55M | |
| 04 The Party's Over (Hopelessly in Love).flac | 2025-02-17 12:27 | 45M | |
| 05 Escape.flac | 2025-02-17 19:56 | 66M | |
| 06 Still They Ride.flac | 2025-02-18 06:33 | 46M | |
| 07 Good Morning Girl.flac | 2025-02-18 17:44 | 19M | |
| 08 Stay Awhile.flac | 2025-02-18 22:45 | 33M | |
| 09 Suzanne.flac | 2025-02-19 05:50 | 46M | |
| 10 Feeling That Way.flac | 2025-02-19 13:57 | 42M | |
| 11 Anytime.flac | 2025-02-19 20:40 | 42M | |
| 12 Walks Like a Lady.flac | 2025-02-20 02:57 | 38M | |
| 13 Little Girl.flac | 2025-02-23 19:04 | 65M | |
| 14 Just the Same Way.flac | 2025-02-23 23:45 | 40M | |
| 15 Patiently.flac | 2025-02-24 03:48 | 39M | |
| 16 When I Think of You.flac | 2025-02-24 07:06 | 51M | |
| 17 Mother, Father (live).flac | 2025-02-24 10:12 | 68M | |
| album.nfo | 2026-01-10 23:44 | 4.2K | |