![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Separate Ways (Worlds Apart).flac | 2025-01-25 19:42 | 42M | |
| 02 Send Her My Love.flac | 2025-01-26 09:16 | 28M | |
| 03 Chain Reaction.flac | 2025-02-17 03:57 | 34M | |
| 04 After the Fall.flac | 2025-02-17 13:05 | 38M | |
| 05 Faithfully.flac | 2025-02-17 21:54 | 31M | |
| 06 Edge of the Blade.flac | 2025-02-18 07:17 | 36M | |
| 07 Troubled Child.flac | 2025-02-18 15:15 | 33M | |
| 08 Back Talk.flac | 2025-02-19 00:17 | 25M | |
| 09 Frontiers.flac | 2025-02-19 07:01 | 32M | |
| 10 Rubicon.flac | 2025-02-19 14:45 | 33M | |
| 11 Only the Young.flac | 2025-02-19 21:20 | 33M | |
| 12 Ask the Lonely.flac | 2025-02-20 03:23 | 32M | |
| 13 Liberty.flac | 2025-02-23 21:12 | 19M | |
| 14 Only Solutions.flac | 2025-02-24 00:30 | 28M | |
| album.nfo | 2026-01-10 23:43 | 3.8K | |